C21H21FN8O2 — CID 139347653
[4-[(2R)-2-azido-3-(tetrazol-2-yl)propoxy]phenyl]-[(3R)-3-(4-fluorophenyl)pyrrolidin-1-yl]methanone (PubChem CID 139347653) has the molecular formula C21H21FN8O2 and a molecular weight of 436.45 g/mol. Its IUPAC name is [4-[(2R)-2-azido-3-(tetrazol-2-yl)propoxy]phenyl]-[(3R)-3-(4-fluorophenyl)pyrrolidin-1-yl]methanone.
| Compound Name | [4-[(2R)-2-azido-3-(tetrazol-2-yl)propoxy]phenyl]-[(3R)-3-(4-fluorophenyl)pyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 139347653 |
| Molecular Formula | C21H21FN8O2 |
| Molecular Weight | 436.45 g/mol |
| Exact Mass | 436.18 |
| IUPAC Name | [4-[(2R)-2-azido-3-(tetrazol-2-yl)propoxy]phenyl]-[(3R)-3-(4-fluorophenyl)pyrrolidin-1-yl]methanone |
| SMILES | [N-]=[N+]=N[C@@H](COc1ccc(C(=O)N2CC[C@H](c3ccc(F)cc3)C2)cc1)Cn1ncnn1 |
| InChI | InChI=1S/C21H21FN8O2/c22-18-5-1-15(2-6-18)17-9-10-29(11-17)21(31)16-3-7-20(8-4-16)32-13-19(26-27-23)12-30-25-14-24-28-30/h1-8,14,17,19H,9-13H2/t17-,19+/m0/s1 |
| InChIKey | ZOGOATUVBWGVIP-PKOBYXMFSA-N |
| XLogP | 3.20 |
| TPSA | 121.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.45 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|