C11H24Cl2N2O — CID 139348524
N-[2-(dimethylamino)ethyl]cyclohexanecarboxamide;dihydrochloride (PubChem CID 139348524) has the molecular formula C11H24Cl2N2O and a molecular weight of 271.23 g/mol. Its IUPAC name is N-[2-(dimethylamino)ethyl]cyclohexanecarboxamide;dihydrochloride.
| Compound Name | N-[2-(dimethylamino)ethyl]cyclohexanecarboxamide;dihydrochloride |
|---|---|
| PubChem CID | 139348524 |
| Molecular Formula | C11H24Cl2N2O |
| Molecular Weight | 271.23 g/mol |
| Exact Mass | 270.13 |
| IUPAC Name | N-[2-(dimethylamino)ethyl]cyclohexanecarboxamide;dihydrochloride |
| SMILES | CN(C)CCNC(=O)C1CCCCC1.Cl.Cl |
| InChI | InChI=1S/C11H22N2O.2ClH/c1-13(2)9-8-12-11(14)10-6-4-3-5-7-10;;/h10H,3-9H2,1-2H3,(H,12,14);2*1H |
| InChIKey | TXALTBRKKHIIDT-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.23 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |