C25H26F3N7O3 — CID 139348656
5-(4-amino-5-cyclopropylpyrrolo[2,1-f][1,2,4]triazin-7-yl)-N-[(3R,4S)-1-(3,3-difluorocyclobutanecarbonyl)-4-fluoropyrrolidin-3-yl]-2-methoxypyridine-3-carboxamide (PubChem CID 139348656) has the molecular formula C25H26F3N7O3 and a molecular weight of 529.52 g/mol. Its IUPAC name is 5-(4-amino-5-cyclopropylpyrrolo[2,1-f][1,2,4]triazin-7-yl)-N-[(3R,4S)-1-(3,3-difluorocyclobutanecarbonyl)-4-fluoropyrrolidin-3-yl]-2-methoxypyridine-3-carboxamide.
| Compound Name | 5-(4-amino-5-cyclopropylpyrrolo[2,1-f][1,2,4]triazin-7-yl)-N-[(3R,4S)-1-(3,3-difluorocyclobutanecarbonyl)-4-fluoropyrrolidin-3-yl]-2-methoxypyridine-3-carboxamide |
|---|---|
| PubChem CID | 139348656 |
| Molecular Formula | C25H26F3N7O3 |
| Molecular Weight | 529.52 g/mol |
| Exact Mass | 529.20 |
| IUPAC Name | 5-(4-amino-5-cyclopropylpyrrolo[2,1-f][1,2,4]triazin-7-yl)-N-[(3R,4S)-1-(3,3-difluorocyclobutanecarbonyl)-4-fluoropyrrolidin-3-yl]-2-methoxypyridine-3-carboxamide |
| SMILES | COc1ncc(-c2cc(C3CC3)c3c(N)ncnn23)cc1C(=O)N[C@@H]1CN(C(=O)C2CC(F)(F)C2)C[C@@H]1F |
| InChI | InChI=1S/C25H26F3N7O3/c1-38-23-16(22(36)33-18-10-34(9-17(18)26)24(37)14-6-25(27,28)7-14)4-13(8-30-23)19-5-15(12-2-3-12)20-21(29)31-11-32-35(19)20/h4-5,8,11-12,14,17-18H,2-3,6-7,9-10H2,1H3,(H,33,36)(H2,29,31,32)/t17-,18+/m0/s1 |
| InChIKey | PVDMKAATSDJCAQ-ZWKOTPCHSA-N |
| XLogP | 2.58 |
| TPSA | 127.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.52 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |