C24H20F6N6O2 — CID 139348984
5-[4-amino-5-(trifluoromethyl)pyrrolo[2,1-f][1,2,4]triazin-7-yl]-2-methyl-N-(4,4,4-trifluoro-3-hydroxy-3-phenylbutyl)pyridine-3-carboxamide (PubChem CID 139348984) has the molecular formula C24H20F6N6O2 and a molecular weight of 538.45 g/mol. Its IUPAC name is 5-[4-amino-5-(trifluoromethyl)pyrrolo[2,1-f][1,2,4]triazin-7-yl]-2-methyl-N-(4,4,4-trifluoro-3-hydroxy-3-phenylbutyl)pyridine-3-carboxamide.
| Compound Name | 5-[4-amino-5-(trifluoromethyl)pyrrolo[2,1-f][1,2,4]triazin-7-yl]-2-methyl-N-(4,4,4-trifluoro-3-hydroxy-3-phenylbutyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 139348984 |
| Molecular Formula | C24H20F6N6O2 |
| Molecular Weight | 538.45 g/mol |
| Exact Mass | 538.16 |
| IUPAC Name | 5-[4-amino-5-(trifluoromethyl)pyrrolo[2,1-f][1,2,4]triazin-7-yl]-2-methyl-N-(4,4,4-trifluoro-3-hydroxy-3-phenylbutyl)pyridine-3-carboxamide |
| SMILES | Cc1ncc(-c2cc(C(F)(F)F)c3c(N)ncnn23)cc1C(=O)NCCC(O)(c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C24H20F6N6O2/c1-13-16(21(37)32-8-7-22(38,24(28,29)30)15-5-3-2-4-6-15)9-14(11-33-13)18-10-17(23(25,26)27)19-20(31)34-12-35-36(18)19/h2-6,9-12,38H,7-8H2,1H3,(H,32,37)(H2,31,34,35) |
| InChIKey | DQIHBBGBNMYWQG-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 118.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.45 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |