C29H23FN6O4 — CID 139349211
1-N-(4-fluorophenyl)-1-N'-[6-[7-methoxy-6-(1H-pyrazol-4-yl)quinolin-4-yl]oxy-3-pyridinyl]cyclopropane-1,1-dicarboxamide (PubChem CID 139349211) has the molecular formula C29H23FN6O4 and a molecular weight of 538.54 g/mol. Its IUPAC name is 1-N-(4-fluorophenyl)-1-N'-[6-[7-methoxy-6-(1H-pyrazol-4-yl)quinolin-4-yl]oxy-3-pyridinyl]cyclopropane-1,1-dicarboxamide.
| Compound Name | 1-N-(4-fluorophenyl)-1-N'-[6-[7-methoxy-6-(1H-pyrazol-4-yl)quinolin-4-yl]oxy-3-pyridinyl]cyclopropane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 139349211 |
| Molecular Formula | C29H23FN6O4 |
| Molecular Weight | 538.54 g/mol |
| Exact Mass | 538.18 |
| IUPAC Name | 1-N-(4-fluorophenyl)-1-N'-[6-[7-methoxy-6-(1H-pyrazol-4-yl)quinolin-4-yl]oxy-3-pyridinyl]cyclopropane-1,1-dicarboxamide |
| SMILES | COc1cc2nccc(Oc3ccc(NC(=O)C4(C(=O)Nc5ccc(F)cc5)CC4)cn3)c2cc1-c1cn[nH]c1 |
| InChI | InChI=1S/C29H23FN6O4/c1-39-25-13-23-22(12-21(25)17-14-33-34-15-17)24(8-11-31-23)40-26-7-6-20(16-32-26)36-28(38)29(9-10-29)27(37)35-19-4-2-18(30)3-5-19/h2-8,11-16H,9-10H2,1H3,(H,33,34)(H,35,37)(H,36,38) |
| InChIKey | UDAUFHAAGAAGNH-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 131.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.54 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|