C30H26FN5O6 — CID 139350133
1-N'-(4-fluorophenyl)-1-N-[4-[7-methoxy-6-(oxetan-3-ylcarbamoyl)quinazolin-4-yl]oxyphenyl]cyclopropane-1,1-dicarboxamide (PubChem CID 139350133) has the molecular formula C30H26FN5O6 and a molecular weight of 571.57 g/mol. Its IUPAC name is 1-N'-(4-fluorophenyl)-1-N-[4-[7-methoxy-6-(oxetan-3-ylcarbamoyl)quinazolin-4-yl]oxyphenyl]cyclopropane-1,1-dicarboxamide.
| Compound Name | 1-N'-(4-fluorophenyl)-1-N-[4-[7-methoxy-6-(oxetan-3-ylcarbamoyl)quinazolin-4-yl]oxyphenyl]cyclopropane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 139350133 |
| Molecular Formula | C30H26FN5O6 |
| Molecular Weight | 571.57 g/mol |
| Exact Mass | 571.19 |
| IUPAC Name | 1-N'-(4-fluorophenyl)-1-N-[4-[7-methoxy-6-(oxetan-3-ylcarbamoyl)quinazolin-4-yl]oxyphenyl]cyclopropane-1,1-dicarboxamide |
| SMILES | COc1cc2ncnc(Oc3ccc(NC(=O)C4(C(=O)Nc5ccc(F)cc5)CC4)cc3)c2cc1C(=O)NC1COC1 |
| InChI | InChI=1S/C30H26FN5O6/c1-40-25-13-24-22(12-23(25)26(37)34-20-14-41-15-20)27(33-16-32-24)42-21-8-6-19(7-9-21)36-29(39)30(10-11-30)28(38)35-18-4-2-17(31)3-5-18/h2-9,12-13,16,20H,10-11,14-15H2,1H3,(H,34,37)(H,35,38)(H,36,39) |
| InChIKey | UAUGLSRIRPRCKG-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 140.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.57 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|