C12H13BrF2N2O — CID 139350236
2-[1-(3-bromophenyl)-3,3-difluorocyclobutyl]acetohydrazide (PubChem CID 139350236) has the molecular formula C12H13BrF2N2O and a molecular weight of 319.15 g/mol. Its IUPAC name is 2-[1-(3-bromophenyl)-3,3-difluorocyclobutyl]acetohydrazide.
| Compound Name | 2-[1-(3-bromophenyl)-3,3-difluorocyclobutyl]acetohydrazide |
|---|---|
| PubChem CID | 139350236 |
| Molecular Formula | C12H13BrF2N2O |
| Molecular Weight | 319.15 g/mol |
| Exact Mass | 318.02 |
| IUPAC Name | 2-[1-(3-bromophenyl)-3,3-difluorocyclobutyl]acetohydrazide |
| SMILES | NNC(=O)CC1(c2cccc(Br)c2)CC(F)(F)C1 |
| InChI | InChI=1S/C12H13BrF2N2O/c13-9-3-1-2-8(4-9)11(5-10(18)17-16)6-12(14,15)7-11/h1-4H,5-7,16H2,(H,17,18) |
| InChIKey | KYSDUQGWFQNGLP-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.15 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|