C30H27FN4O6 — CID 139350600
1-N-[4-[6-carbamoyl-7-(2-methoxyethoxy)quinolin-4-yl]oxyphenyl]-1-N'-(4-fluorophenyl)cyclopropane-1,1-dicarboxamide (PubChem CID 139350600) has the molecular formula C30H27FN4O6 and a molecular weight of 558.57 g/mol. Its IUPAC name is 1-N-[4-[6-carbamoyl-7-(2-methoxyethoxy)quinolin-4-yl]oxyphenyl]-1-N'-(4-fluorophenyl)cyclopropane-1,1-dicarboxamide.
| Compound Name | 1-N-[4-[6-carbamoyl-7-(2-methoxyethoxy)quinolin-4-yl]oxyphenyl]-1-N'-(4-fluorophenyl)cyclopropane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 139350600 |
| Molecular Formula | C30H27FN4O6 |
| Molecular Weight | 558.57 g/mol |
| Exact Mass | 558.19 |
| IUPAC Name | 1-N-[4-[6-carbamoyl-7-(2-methoxyethoxy)quinolin-4-yl]oxyphenyl]-1-N'-(4-fluorophenyl)cyclopropane-1,1-dicarboxamide |
| SMILES | COCCOc1cc2nccc(Oc3ccc(NC(=O)C4(C(=O)Nc5ccc(F)cc5)CC4)cc3)c2cc1C(N)=O |
| InChI | InChI=1S/C30H27FN4O6/c1-39-14-15-40-26-17-24-22(16-23(26)27(32)36)25(10-13-33-24)41-21-8-6-20(7-9-21)35-29(38)30(11-12-30)28(37)34-19-4-2-18(31)3-5-19/h2-10,13,16-17H,11-12,14-15H2,1H3,(H2,32,36)(H,34,37)(H,35,38) |
| InChIKey | SBHFVRPLOFSBNM-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 141.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.57 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|