About 2-(3-nitrophenyl)propyl methanesulfonate
2-(3-nitrophenyl)propyl methanesulfonate (PubChem CID 139350625) has the molecular formula C10H13NO5S
and a molecular weight of 259.28 g/mol. Its IUPAC name is 2-(3-nitrophenyl)propyl methanesulfonate.
Molecular Properties
| Compound Name | 2-(3-nitrophenyl)propyl methanesulfonate |
| PubChem CID | 139350625 |
| Molecular Formula | C10H13NO5S |
| Molecular Weight | 259.28 g/mol |
| Exact Mass | 259.05 |
| IUPAC Name | 2-(3-nitrophenyl)propyl methanesulfonate |
| SMILES | CC(COS(C)(=O)=O)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C10H13NO5S/c1-8(7-16-17(2,14)15)9-4-3-5-10(6-9)11(12)13/h3-6,8H,7H2,1-2H3 |
| InChIKey | NWLDKHDMEPDRAN-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 86.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.28 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze 2-(3-nitrophenyl)propyl methanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-nitrophenyl)propyl methanesulfonate?
The IUPAC name of 2-(3-nitrophenyl)propyl methanesulfonate (CID 139350625) is 2-(3-nitrophenyl)propyl methanesulfonate.
What is the SMILES notation for 2-(3-nitrophenyl)propyl methanesulfonate?
The canonical SMILES for 2-(3-nitrophenyl)propyl methanesulfonate is CC(COS(C)(=O)=O)c1cccc([N+](=O)[O-])c1.
What is the InChIKey of 2-(3-nitrophenyl)propyl methanesulfonate?
The InChIKey is NWLDKHDMEPDRAN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NO5S/c1-8(7-16-17(2,14)15)9-4-3-5-10(6-9)11(12)13/h3-6,8H,7H2,1-2H3.
What are the key properties of 2-(3-nitrophenyl)propyl methanesulfonate?
2-(3-nitrophenyl)propyl methanesulfonate has a molecular weight of 259.28 g/mol, XLogP of 1.67, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-nitrophenyl)propyl methanesulfonate is sourced from PubChem (CID 139350625), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).