C33H40N6O4 — CID 139351411
ethyl 6-tert-butyl-4-[[(1S,4R)-4-[(3-tert-butyl-[1,2,4]triazolo[4,3-a]pyridin-6-yl)oxy]-1,2,3,4-tetrahydronaphthalen-1-yl]carbamoylamino]pyridine-2-carboxylate (PubChem CID 139351411) has the molecular formula C33H40N6O4 and a molecular weight of 584.72 g/mol. Its IUPAC name is ethyl 6-tert-butyl-4-[[(1S,4R)-4-[(3-tert-butyl-[1,2,4]triazolo[4,3-a]pyridin-6-yl)oxy]-1,2,3,4-tetrahydronaphthalen-1-yl]carbamoylamino]pyridine-2-carboxylate.
| Compound Name | ethyl 6-tert-butyl-4-[[(1S,4R)-4-[(3-tert-butyl-[1,2,4]triazolo[4,3-a]pyridin-6-yl)oxy]-1,2,3,4-tetrahydronaphthalen-1-yl]carbamoylamino]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 139351411 |
| Molecular Formula | C33H40N6O4 |
| Molecular Weight | 584.72 g/mol |
| Exact Mass | 584.31 |
| IUPAC Name | ethyl 6-tert-butyl-4-[[(1S,4R)-4-[(3-tert-butyl-[1,2,4]triazolo[4,3-a]pyridin-6-yl)oxy]-1,2,3,4-tetrahydronaphthalen-1-yl]carbamoylamino]pyridine-2-carboxylate |
| SMILES | CCOC(=O)c1cc(NC(=O)N[C@H]2CC[C@@H](Oc3ccc4nnc(C(C)(C)C)n4c3)c3ccccc32)cc(C(C)(C)C)n1 |
| InChI | InChI=1S/C33H40N6O4/c1-8-42-29(40)25-17-20(18-27(35-25)32(2,3)4)34-31(41)36-24-14-15-26(23-12-10-9-11-22(23)24)43-21-13-16-28-37-38-30(33(5,6)7)39(28)19-21/h9-13,16-19,24,26H,8,14-15H2,1-7H3,(H2,34,35,36,41)/t24-,26+/m0/s1 |
| InChIKey | RYSVFXBORQYEAW-AZGAKELHSA-N |
| XLogP | 6.67 |
| TPSA | 119.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.72 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |