About 6-tert-butyl-2-(4-methylpiperazin-1-yl)-1,4-dihydropyrimidine
6-tert-butyl-2-(4-methylpiperazin-1-yl)-1,4-dihydropyrimidine (PubChem CID 139351424) has the molecular formula C13H24N4
and a molecular weight of 236.36 g/mol. Its IUPAC name is 6-tert-butyl-2-(4-methylpiperazin-1-yl)-1,4-dihydropyrimidine.
Molecular Properties
| Compound Name | 6-tert-butyl-2-(4-methylpiperazin-1-yl)-1,4-dihydropyrimidine |
| PubChem CID | 139351424 |
| Molecular Formula | C13H24N4 |
| Molecular Weight | 236.36 g/mol |
| Exact Mass | 236.20 |
| IUPAC Name | 6-tert-butyl-2-(4-methylpiperazin-1-yl)-1,4-dihydropyrimidine |
| SMILES | CN1CCN(C2=NCC=C(C(C)(C)C)N2)CC1 |
| InChI | InChI=1S/C13H24N4/c1-13(2,3)11-5-6-14-12(15-11)17-9-7-16(4)8-10-17/h5H,6-10H2,1-4H3,(H,14,15) |
| InChIKey | AAWRPDCKAJXDLP-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 30.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.36 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-tert-butyl-2-(4-methylpiperazin-1-yl)-1,4-dihydropyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-tert-butyl-2-(4-methylpiperazin-1-yl)-1,4-dihydropyrimidine?
The IUPAC name of 6-tert-butyl-2-(4-methylpiperazin-1-yl)-1,4-dihydropyrimidine (CID 139351424) is 6-tert-butyl-2-(4-methylpiperazin-1-yl)-1,4-dihydropyrimidine.
What is the SMILES notation for 6-tert-butyl-2-(4-methylpiperazin-1-yl)-1,4-dihydropyrimidine?
The canonical SMILES for 6-tert-butyl-2-(4-methylpiperazin-1-yl)-1,4-dihydropyrimidine is CN1CCN(C2=NCC=C(C(C)(C)C)N2)CC1.
What is the InChIKey of 6-tert-butyl-2-(4-methylpiperazin-1-yl)-1,4-dihydropyrimidine?
The InChIKey is AAWRPDCKAJXDLP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H24N4/c1-13(2,3)11-5-6-14-12(15-11)17-9-7-16(4)8-10-17/h5H,6-10H2,1-4H3,(H,14,15).
What are the key properties of 6-tert-butyl-2-(4-methylpiperazin-1-yl)-1,4-dihydropyrimidine?
6-tert-butyl-2-(4-methylpiperazin-1-yl)-1,4-dihydropyrimidine has a molecular weight of 236.36 g/mol, XLogP of 1.12, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-tert-butyl-2-(4-methylpiperazin-1-yl)-1,4-dihydropyrimidine is sourced from PubChem (CID 139351424), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).