About 3-benzyl-7-(furan-2-ylmethyl)-5,6-diphenylpyrrolo[2,3-d]pyrimidin-4-imine
3-benzyl-7-(furan-2-ylmethyl)-5,6-diphenylpyrrolo[2,3-d]pyrimidin-4-imine (PubChem CID 1393517) has the molecular formula C30H24N4O
and a molecular weight of 456.55 g/mol. Its IUPAC name is 3-benzyl-7-(furan-2-ylmethyl)-5,6-diphenylpyrrolo[2,3-d]pyrimidin-4-imine.
Molecular Properties
| Compound Name | 3-benzyl-7-(furan-2-ylmethyl)-5,6-diphenylpyrrolo[2,3-d]pyrimidin-4-imine |
| PubChem CID | 1393517 |
| Molecular Formula | C30H24N4O |
| Molecular Weight | 456.55 g/mol |
| Exact Mass | 456.20 |
| IUPAC Name | 3-benzyl-7-(furan-2-ylmethyl)-5,6-diphenylpyrrolo[2,3-d]pyrimidin-4-imine |
| SMILES | [H]/N=c1/c2c(-c3ccccc3)c(-c3ccccc3)n(Cc3ccco3)c2ncn1Cc1ccccc1 |
| InChI | InChI=1S/C30H24N4O/c31-29-27-26(23-13-6-2-7-14-23)28(24-15-8-3-9-16-24)34(20-25-17-10-18-35-25)30(27)32-21-33(29)19-22-11-4-1-5-12-22/h1-18,21,31H,19-20H2/b31-29- |
| InChIKey | CUPZHICIEZAUQQ-YCNYHXFESA-N |
| XLogP | 6.34 |
| TPSA | 59.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 456.55 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-benzyl-7-(furan-2-ylmethyl)-5,6-diphenylpyrrolo[2,3-d]pyrimidin-4-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-benzyl-7-(furan-2-ylmethyl)-5,6-diphenylpyrrolo[2,3-d]pyrimidin-4-imine?
The IUPAC name of 3-benzyl-7-(furan-2-ylmethyl)-5,6-diphenylpyrrolo[2,3-d]pyrimidin-4-imine (CID 1393517) is 3-benzyl-7-(furan-2-ylmethyl)-5,6-diphenylpyrrolo[2,3-d]pyrimidin-4-imine.
What is the SMILES notation for 3-benzyl-7-(furan-2-ylmethyl)-5,6-diphenylpyrrolo[2,3-d]pyrimidin-4-imine?
The canonical SMILES for 3-benzyl-7-(furan-2-ylmethyl)-5,6-diphenylpyrrolo[2,3-d]pyrimidin-4-imine is [H]/N=c1/c2c(-c3ccccc3)c(-c3ccccc3)n(Cc3ccco3)c2ncn1Cc1ccccc1.
What is the InChIKey of 3-benzyl-7-(furan-2-ylmethyl)-5,6-diphenylpyrrolo[2,3-d]pyrimidin-4-imine?
The InChIKey is CUPZHICIEZAUQQ-YCNYHXFESA-N. The full InChI is InChI=1S/C30H24N4O/c31-29-27-26(23-13-6-2-7-14-23)28(24-15-8-3-9-16-24)34(20-25-17-10-18-35-25)30(27)32-21-33(29)19-22-11-4-1-5-12-22/h1-18,21,31H,19-20H2/b31-29-.
What are the key properties of 3-benzyl-7-(furan-2-ylmethyl)-5,6-diphenylpyrrolo[2,3-d]pyrimidin-4-imine?
3-benzyl-7-(furan-2-ylmethyl)-5,6-diphenylpyrrolo[2,3-d]pyrimidin-4-imine has a molecular weight of 456.55 g/mol, XLogP of 6.34, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-benzyl-7-(furan-2-ylmethyl)-5,6-diphenylpyrrolo[2,3-d]pyrimidin-4-imine is sourced from PubChem (CID 1393517), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).