C24H25N7O2 — CID 139351705
ethyl 1-[3-(3-hydrazinylphenyl)phenyl]-5-[(1R,2R)-2-(1-methyltriazol-4-yl)cyclopropyl]pyrazole-4-carboxylate (PubChem CID 139351705) has the molecular formula C24H25N7O2 and a molecular weight of 443.51 g/mol. Its IUPAC name is ethyl 1-[3-(3-hydrazinylphenyl)phenyl]-5-[(1R,2R)-2-(1-methyltriazol-4-yl)cyclopropyl]pyrazole-4-carboxylate.
| Compound Name | ethyl 1-[3-(3-hydrazinylphenyl)phenyl]-5-[(1R,2R)-2-(1-methyltriazol-4-yl)cyclopropyl]pyrazole-4-carboxylate |
|---|---|
| PubChem CID | 139351705 |
| Molecular Formula | C24H25N7O2 |
| Molecular Weight | 443.51 g/mol |
| Exact Mass | 443.21 |
| IUPAC Name | ethyl 1-[3-(3-hydrazinylphenyl)phenyl]-5-[(1R,2R)-2-(1-methyltriazol-4-yl)cyclopropyl]pyrazole-4-carboxylate |
| SMILES | CCOC(=O)c1cnn(-c2cccc(-c3cccc(NN)c3)c2)c1[C@@H]1C[C@H]1c1cn(C)nn1 |
| InChI | InChI=1S/C24H25N7O2/c1-3-33-24(32)21-13-26-31(23(21)20-12-19(20)22-14-30(2)29-28-22)18-9-5-7-16(11-18)15-6-4-8-17(10-15)27-25/h4-11,13-14,19-20,27H,3,12,25H2,1-2H3/t19-,20-/m1/s1 |
| InChIKey | DHRPMEWHCUXRND-WOJBJXKFSA-N |
| XLogP | 3.40 |
| TPSA | 112.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.51 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|