C61H50N4 — CID 139352247
2-[4-[3-[(3E,5E)-5,7-bis[2-(4-pyridin-2-ylphenyl)phenyl]hepta-1,3,5-trien-3-yl]-2-pyridinyl]phenyl]-4-tert-butylpyridine (PubChem CID 139352247) has the molecular formula C61H50N4 and a molecular weight of 839.10 g/mol. Its IUPAC name is 2-[4-[3-[(3E,5E)-5,7-bis[2-(4-pyridin-2-ylphenyl)phenyl]hepta-1,3,5-trien-3-yl]-2-pyridinyl]phenyl]-4-tert-butylpyridine.
| Compound Name | 2-[4-[3-[(3E,5E)-5,7-bis[2-(4-pyridin-2-ylphenyl)phenyl]hepta-1,3,5-trien-3-yl]-2-pyridinyl]phenyl]-4-tert-butylpyridine |
|---|---|
| PubChem CID | 139352247 |
| Molecular Formula | C61H50N4 |
| Molecular Weight | 839.10 g/mol |
| Exact Mass | 838.40 |
| IUPAC Name | 2-[4-[3-[(3E,5E)-5,7-bis[2-(4-pyridin-2-ylphenyl)phenyl]hepta-1,3,5-trien-3-yl]-2-pyridinyl]phenyl]-4-tert-butylpyridine |
| SMILES | C=C/C(=C\C(=C/Cc1ccccc1-c1ccc(-c2ccccn2)cc1)c1ccccc1-c1ccc(-c2ccccn2)cc1)c1cccnc1-c1ccc(-c2cc(C(C)(C)C)ccn2)cc1 |
| InChI | InChI=1S/C61H50N4/c1-5-43(56-19-14-39-65-60(56)50-33-31-49(32-34-50)59-42-52(36-40-64-59)61(2,3)4)41-51(55-18-9-8-17-54(55)46-24-29-48(30-25-46)58-21-11-13-38-63-58)35-26-44-15-6-7-16-53(44)45-22-27-47(28-23-45)57-20-10-12-37-62-57/h5-25,27-42H,1,26H2,2-4H3/b43-41+,51-35+ |
| InChIKey | ZIRORDRHCSRGHT-FGMJJUNASA-N |
| XLogP | 15.46 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 839.10 |
| LogP ≤ 5 | 15.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|