C23H29O6P3 — CID 139352463
(1E,4E)-1-[3,5-bis(dimethylphosphoryloxy)phenyl]-5-(3-dimethylphosphanyloxyphenyl)penta-1,4-dien-3-one (PubChem CID 139352463) has the molecular formula C23H29O6P3 and a molecular weight of 494.40 g/mol. Its IUPAC name is (1E,4E)-1-[3,5-bis(dimethylphosphoryloxy)phenyl]-5-(3-dimethylphosphanyloxyphenyl)penta-1,4-dien-3-one.
| Compound Name | (1E,4E)-1-[3,5-bis(dimethylphosphoryloxy)phenyl]-5-(3-dimethylphosphanyloxyphenyl)penta-1,4-dien-3-one |
|---|---|
| PubChem CID | 139352463 |
| Molecular Formula | C23H29O6P3 |
| Molecular Weight | 494.40 g/mol |
| Exact Mass | 494.12 |
| IUPAC Name | (1E,4E)-1-[3,5-bis(dimethylphosphoryloxy)phenyl]-5-(3-dimethylphosphanyloxyphenyl)penta-1,4-dien-3-one |
| SMILES | CP(C)Oc1cccc(/C=C/C(=O)/C=C/c2cc(OP(C)(C)=O)cc(OP(C)(C)=O)c2)c1 |
| InChI | InChI=1S/C23H29O6P3/c1-30(2)27-21-9-7-8-18(14-21)10-12-20(24)13-11-19-15-22(28-31(3,4)25)17-23(16-19)29-32(5,6)26/h7-17H,1-6H3/b12-10+,13-11+ |
| InChIKey | DHAMLEZYFSCDFU-DCIPZJNNSA-N |
| XLogP | 6.85 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.40 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|