C32H36N4O4 — CID 139352964
(Z)-3-[[6-[2-[[2-(cyclobutylmethyl)-3,4-dihydro-1H-isoquinolin-6-yl]methoxy]-3-methylphenyl]-2-pyridinyl]amino]-2-methanimidoyl-3-methoxyprop-2-enoic acid (PubChem CID 139352964) has the molecular formula C32H36N4O4 and a molecular weight of 540.66 g/mol. Its IUPAC name is (Z)-3-[[6-[2-[[2-(cyclobutylmethyl)-3,4-dihydro-1H-isoquinolin-6-yl]methoxy]-3-methylphenyl]-2-pyridinyl]amino]-2-methanimidoyl-3-methoxyprop-2-enoic acid.
| Compound Name | (Z)-3-[[6-[2-[[2-(cyclobutylmethyl)-3,4-dihydro-1H-isoquinolin-6-yl]methoxy]-3-methylphenyl]-2-pyridinyl]amino]-2-methanimidoyl-3-methoxyprop-2-enoic acid |
|---|---|
| PubChem CID | 139352964 |
| Molecular Formula | C32H36N4O4 |
| Molecular Weight | 540.66 g/mol |
| Exact Mass | 540.27 |
| IUPAC Name | (Z)-3-[[6-[2-[[2-(cyclobutylmethyl)-3,4-dihydro-1H-isoquinolin-6-yl]methoxy]-3-methylphenyl]-2-pyridinyl]amino]-2-methanimidoyl-3-methoxyprop-2-enoic acid |
| SMILES | [H]/N=C/C(C(=O)O)=C(\Nc1cccc(-c2cccc(C)c2OCc2ccc3c(c2)CCN(CC2CCC2)C3)n1)OC |
| InChI | InChI=1S/C32H36N4O4/c1-21-6-3-9-26(28-10-5-11-29(34-28)35-31(39-2)27(17-33)32(37)38)30(21)40-20-23-12-13-25-19-36(15-14-24(25)16-23)18-22-7-4-8-22/h3,5-6,9-13,16-17,22,33H,4,7-8,14-15,18-20H2,1-2H3,(H,34,35)(H,37,38)/b31-27-,33-17+ |
| InChIKey | UDZKBLIXMKOIAJ-SCEIRTGHSA-N |
| XLogP | 5.80 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.66 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|