About N-(2,3-dimethylbut-2-enyl)-N-methyloxan-4-amine
N-(2,3-dimethylbut-2-enyl)-N-methyloxan-4-amine (PubChem CID 139353040) has the molecular formula C12H23NO
and a molecular weight of 197.32 g/mol. Its IUPAC name is N-(2,3-dimethylbut-2-enyl)-N-methyloxan-4-amine.
Molecular Properties
| Compound Name | N-(2,3-dimethylbut-2-enyl)-N-methyloxan-4-amine |
| PubChem CID | 139353040 |
| Molecular Formula | C12H23NO |
| Molecular Weight | 197.32 g/mol |
| Exact Mass | 197.18 |
| IUPAC Name | N-(2,3-dimethylbut-2-enyl)-N-methyloxan-4-amine |
| SMILES | CC(C)=C(C)CN(C)C1CCOCC1 |
| InChI | InChI=1S/C12H23NO/c1-10(2)11(3)9-13(4)12-5-7-14-8-6-12/h12H,5-9H2,1-4H3 |
| InChIKey | VYXGFNGLZYTVJE-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.32 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-(2,3-dimethylbut-2-enyl)-N-methyloxan-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2,3-dimethylbut-2-enyl)-N-methyloxan-4-amine?
The IUPAC name of N-(2,3-dimethylbut-2-enyl)-N-methyloxan-4-amine (CID 139353040) is N-(2,3-dimethylbut-2-enyl)-N-methyloxan-4-amine.
What is the SMILES notation for N-(2,3-dimethylbut-2-enyl)-N-methyloxan-4-amine?
The canonical SMILES for N-(2,3-dimethylbut-2-enyl)-N-methyloxan-4-amine is CC(C)=C(C)CN(C)C1CCOCC1.
What is the InChIKey of N-(2,3-dimethylbut-2-enyl)-N-methyloxan-4-amine?
The InChIKey is VYXGFNGLZYTVJE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23NO/c1-10(2)11(3)9-13(4)12-5-7-14-8-6-12/h12H,5-9H2,1-4H3.
What are the key properties of N-(2,3-dimethylbut-2-enyl)-N-methyloxan-4-amine?
N-(2,3-dimethylbut-2-enyl)-N-methyloxan-4-amine has a molecular weight of 197.32 g/mol, XLogP of 2.45, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2,3-dimethylbut-2-enyl)-N-methyloxan-4-amine is sourced from PubChem (CID 139353040), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).