About N-[(2R)-4-methoxybutan-2-yl]-3,3-dimethylpentan-1-amine
N-[(2R)-4-methoxybutan-2-yl]-3,3-dimethylpentan-1-amine (PubChem CID 139353206) has the molecular formula C12H27NO
and a molecular weight of 201.35 g/mol. Its IUPAC name is N-[(2R)-4-methoxybutan-2-yl]-3,3-dimethylpentan-1-amine.
Molecular Properties
| Compound Name | N-[(2R)-4-methoxybutan-2-yl]-3,3-dimethylpentan-1-amine |
| PubChem CID | 139353206 |
| Molecular Formula | C12H27NO |
| Molecular Weight | 201.35 g/mol |
| Exact Mass | 201.21 |
| IUPAC Name | N-[(2R)-4-methoxybutan-2-yl]-3,3-dimethylpentan-1-amine |
| SMILES | CCC(C)(C)CCN[C@H](C)CCOC |
| InChI | InChI=1S/C12H27NO/c1-6-12(3,4)8-9-13-11(2)7-10-14-5/h11,13H,6-10H2,1-5H3/t11-/m1/s1 |
| InChIKey | KXVZAJGRMSVXIP-LLVKDONJSA-N |
| XLogP | 2.83 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.35 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-[(2R)-4-methoxybutan-2-yl]-3,3-dimethylpentan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2R)-4-methoxybutan-2-yl]-3,3-dimethylpentan-1-amine?
The IUPAC name of N-[(2R)-4-methoxybutan-2-yl]-3,3-dimethylpentan-1-amine (CID 139353206) is N-[(2R)-4-methoxybutan-2-yl]-3,3-dimethylpentan-1-amine.
What is the SMILES notation for N-[(2R)-4-methoxybutan-2-yl]-3,3-dimethylpentan-1-amine?
The canonical SMILES for N-[(2R)-4-methoxybutan-2-yl]-3,3-dimethylpentan-1-amine is CCC(C)(C)CCN[C@H](C)CCOC.
What is the InChIKey of N-[(2R)-4-methoxybutan-2-yl]-3,3-dimethylpentan-1-amine?
The InChIKey is KXVZAJGRMSVXIP-LLVKDONJSA-N. The full InChI is InChI=1S/C12H27NO/c1-6-12(3,4)8-9-13-11(2)7-10-14-5/h11,13H,6-10H2,1-5H3/t11-/m1/s1.
What are the key properties of N-[(2R)-4-methoxybutan-2-yl]-3,3-dimethylpentan-1-amine?
N-[(2R)-4-methoxybutan-2-yl]-3,3-dimethylpentan-1-amine has a molecular weight of 201.35 g/mol, XLogP of 2.83, 8 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2R)-4-methoxybutan-2-yl]-3,3-dimethylpentan-1-amine is sourced from PubChem (CID 139353206), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).