C22H32N2 — CID 139353322
(Z)-N-methyl-1-[5-methyl-6-[(Z)-5-(1,2,3,6-tetrahydropyridin-5-yl)pent-4-enyl]cyclohexa-1,5-dien-1-yl]but-2-en-1-imine (PubChem CID 139353322) has the molecular formula C22H32N2 and a molecular weight of 324.51 g/mol. Its IUPAC name is (Z)-N-methyl-1-[5-methyl-6-[(Z)-5-(1,2,3,6-tetrahydropyridin-5-yl)pent-4-enyl]cyclohexa-1,5-dien-1-yl]but-2-en-1-imine.
| Compound Name | (Z)-N-methyl-1-[5-methyl-6-[(Z)-5-(1,2,3,6-tetrahydropyridin-5-yl)pent-4-enyl]cyclohexa-1,5-dien-1-yl]but-2-en-1-imine |
|---|---|
| PubChem CID | 139353322 |
| Molecular Formula | C22H32N2 |
| Molecular Weight | 324.51 g/mol |
| Exact Mass | 324.26 |
| IUPAC Name | (Z)-N-methyl-1-[5-methyl-6-[(Z)-5-(1,2,3,6-tetrahydropyridin-5-yl)pent-4-enyl]cyclohexa-1,5-dien-1-yl]but-2-en-1-imine |
| SMILES | C/C=C\C(=N/C)C1=CCCC(C)=C1CCC/C=C\C1=CCCNC1 |
| InChI | InChI=1S/C22H32N2/c1-4-10-22(23-3)21-15-8-11-18(2)20(21)14-7-5-6-12-19-13-9-16-24-17-19/h4,6,10,12-13,15,24H,5,7-9,11,14,16-17H2,1-3H3/b10-4-,12-6-,23-22+ |
| InChIKey | LNEADNNXOHXPFV-DWTULXQHSA-N |
| XLogP | 5.32 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.51 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|