C18H30FN — CID 139353510
N-[(2E,3Z,5Z)-2-ethylidenehepta-3,5-dienyl]-2-fluoro-N-propylcyclohexan-1-amine (PubChem CID 139353510) has the molecular formula C18H30FN and a molecular weight of 279.44 g/mol. Its IUPAC name is N-[(2E,3Z,5Z)-2-ethylidenehepta-3,5-dienyl]-2-fluoro-N-propylcyclohexan-1-amine.
| Compound Name | N-[(2E,3Z,5Z)-2-ethylidenehepta-3,5-dienyl]-2-fluoro-N-propylcyclohexan-1-amine |
|---|---|
| PubChem CID | 139353510 |
| Molecular Formula | C18H30FN |
| Molecular Weight | 279.44 g/mol |
| Exact Mass | 279.24 |
| IUPAC Name | N-[(2E,3Z,5Z)-2-ethylidenehepta-3,5-dienyl]-2-fluoro-N-propylcyclohexan-1-amine |
| SMILES | C/C=C\C=C/C(=C\C)CN(CCC)C1CCCCC1F |
| InChI | InChI=1S/C18H30FN/c1-4-7-8-11-16(6-3)15-20(14-5-2)18-13-10-9-12-17(18)19/h4,6-8,11,17-18H,5,9-10,12-15H2,1-3H3/b7-4-,11-8-,16-6+ |
| InChIKey | CVXUPUWSQVDDTH-WRQMWTFFSA-N |
| XLogP | 5.06 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.44 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|