C29H29F2N7O4 — CID 139353656
2-[(4S)-1-acetyl-3,3-difluoropiperidin-4-yl]oxy-5-[4-[4-[2-[(E)-2-hydroxyethenyl]morpholin-4-yl]anilino]-1,3,5-triazin-2-yl]benzonitrile (PubChem CID 139353656) has the molecular formula C29H29F2N7O4 and a molecular weight of 577.59 g/mol. Its IUPAC name is 2-[(4S)-1-acetyl-3,3-difluoropiperidin-4-yl]oxy-5-[4-[4-[2-[(E)-2-hydroxyethenyl]morpholin-4-yl]anilino]-1,3,5-triazin-2-yl]benzonitrile.
| Compound Name | 2-[(4S)-1-acetyl-3,3-difluoropiperidin-4-yl]oxy-5-[4-[4-[2-[(E)-2-hydroxyethenyl]morpholin-4-yl]anilino]-1,3,5-triazin-2-yl]benzonitrile |
|---|---|
| PubChem CID | 139353656 |
| Molecular Formula | C29H29F2N7O4 |
| Molecular Weight | 577.59 g/mol |
| Exact Mass | 577.22 |
| IUPAC Name | 2-[(4S)-1-acetyl-3,3-difluoropiperidin-4-yl]oxy-5-[4-[4-[2-[(E)-2-hydroxyethenyl]morpholin-4-yl]anilino]-1,3,5-triazin-2-yl]benzonitrile |
| SMILES | CC(=O)N1CC[C@H](Oc2ccc(-c3ncnc(Nc4ccc(N5CCOC(/C=C/O)C5)cc4)n3)cc2C#N)C(F)(F)C1 |
| InChI | InChI=1S/C29H29F2N7O4/c1-19(40)38-10-8-26(29(30,31)17-38)42-25-7-2-20(14-21(25)15-32)27-33-18-34-28(36-27)35-22-3-5-23(6-4-22)37-11-13-41-24(16-37)9-12-39/h2-7,9,12,14,18,24,26,39H,8,10-11,13,16-17H2,1H3,(H,33,34,35,36)/b12-9+/t24?,26-/m0/s1 |
| InChIKey | LLCXFUAZYBXLAO-JONWXKESSA-N |
| XLogP | 4.07 |
| TPSA | 136.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.59 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|