C16H25FN2O — CID 139353776
1-[(1Z,3Z)-1-fluoro-5-methylhexa-1,3,5-trien-2-yl]-4-(oxan-4-yl)piperazine (PubChem CID 139353776) has the molecular formula C16H25FN2O and a molecular weight of 280.39 g/mol. Its IUPAC name is 1-[(1Z,3Z)-1-fluoro-5-methylhexa-1,3,5-trien-2-yl]-4-(oxan-4-yl)piperazine.
| Compound Name | 1-[(1Z,3Z)-1-fluoro-5-methylhexa-1,3,5-trien-2-yl]-4-(oxan-4-yl)piperazine |
|---|---|
| PubChem CID | 139353776 |
| Molecular Formula | C16H25FN2O |
| Molecular Weight | 280.39 g/mol |
| Exact Mass | 280.20 |
| IUPAC Name | 1-[(1Z,3Z)-1-fluoro-5-methylhexa-1,3,5-trien-2-yl]-4-(oxan-4-yl)piperazine |
| SMILES | C=C(C)/C=C\C(=C\F)N1CCN(C2CCOCC2)CC1 |
| InChI | InChI=1S/C16H25FN2O/c1-14(2)3-4-16(13-17)19-9-7-18(8-10-19)15-5-11-20-12-6-15/h3-4,13,15H,1,5-12H2,2H3/b4-3-,16-13- |
| InChIKey | FHRCKLXGQUFFBZ-DOYVMUTJSA-N |
| XLogP | 2.73 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.39 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|