C14H22FN3O2 — CID 139353830
(2Z,3Z)-4-amino-2-(aminomethylidene)-1-[(4S)-3-fluoro-4-methoxypiperidin-1-yl]hepta-3,6-dien-1-one (PubChem CID 139353830) has the molecular formula C14H22FN3O2 and a molecular weight of 283.35 g/mol. Its IUPAC name is (2Z,3Z)-4-amino-2-(aminomethylidene)-1-[(4S)-3-fluoro-4-methoxypiperidin-1-yl]hepta-3,6-dien-1-one.
| Compound Name | (2Z,3Z)-4-amino-2-(aminomethylidene)-1-[(4S)-3-fluoro-4-methoxypiperidin-1-yl]hepta-3,6-dien-1-one |
|---|---|
| PubChem CID | 139353830 |
| Molecular Formula | C14H22FN3O2 |
| Molecular Weight | 283.35 g/mol |
| Exact Mass | 283.17 |
| IUPAC Name | (2Z,3Z)-4-amino-2-(aminomethylidene)-1-[(4S)-3-fluoro-4-methoxypiperidin-1-yl]hepta-3,6-dien-1-one |
| SMILES | C=CC/C(N)=C/C(=C/N)C(=O)N1CC[C@H](OC)C(F)C1 |
| InChI | InChI=1S/C14H22FN3O2/c1-3-4-11(17)7-10(8-16)14(19)18-6-5-13(20-2)12(15)9-18/h3,7-8,12-13H,1,4-6,9,16-17H2,2H3/b10-8-,11-7-/t12?,13-/m0/s1 |
| InChIKey | UKSBXNFTQOIYMI-QVWAGUFISA-N |
| XLogP | 0.83 |
| TPSA | 81.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.35 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|