About (E)-1-methoxybut-1-ene-1,2-diamine
(E)-1-methoxybut-1-ene-1,2-diamine (PubChem CID 139354738) has the molecular formula C5H12N2O
and a molecular weight of 116.16 g/mol. Its IUPAC name is (E)-1-methoxybut-1-ene-1,2-diamine.
Molecular Properties
| Compound Name | (E)-1-methoxybut-1-ene-1,2-diamine |
| PubChem CID | 139354738 |
| Molecular Formula | C5H12N2O |
| Molecular Weight | 116.16 g/mol |
| Exact Mass | 116.09 |
| IUPAC Name | (E)-1-methoxybut-1-ene-1,2-diamine |
| SMILES | CC/C(N)=C(/N)OC |
| InChI | InChI=1S/C5H12N2O/c1-3-4(6)5(7)8-2/h3,6-7H2,1-2H3/b5-4+ |
| InChIKey | KQZJGARWXRWLCI-SNAWJCMRSA-N |
| XLogP | 0.13 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 116.16 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze (E)-1-methoxybut-1-ene-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-1-methoxybut-1-ene-1,2-diamine?
The IUPAC name of (E)-1-methoxybut-1-ene-1,2-diamine (CID 139354738) is (E)-1-methoxybut-1-ene-1,2-diamine.
What is the SMILES notation for (E)-1-methoxybut-1-ene-1,2-diamine?
The canonical SMILES for (E)-1-methoxybut-1-ene-1,2-diamine is CC/C(N)=C(/N)OC.
What is the InChIKey of (E)-1-methoxybut-1-ene-1,2-diamine?
The InChIKey is KQZJGARWXRWLCI-SNAWJCMRSA-N. The full InChI is InChI=1S/C5H12N2O/c1-3-4(6)5(7)8-2/h3,6-7H2,1-2H3/b5-4+.
What are the key properties of (E)-1-methoxybut-1-ene-1,2-diamine?
(E)-1-methoxybut-1-ene-1,2-diamine has a molecular weight of 116.16 g/mol, XLogP of 0.13, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-1-methoxybut-1-ene-1,2-diamine is sourced from PubChem (CID 139354738), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).