About 3-(4-amino-2-methylsulfanyl-1,3-thiazol-5-yl)-2,2-dimethyl-3-oxopropanenitrile
3-(4-amino-2-methylsulfanyl-1,3-thiazol-5-yl)-2,2-dimethyl-3-oxopropanenitrile (PubChem CID 139355688) has the molecular formula C9H11N3OS2
and a molecular weight of 241.34 g/mol. Its IUPAC name is 3-(4-amino-2-methylsulfanyl-1,3-thiazol-5-yl)-2,2-dimethyl-3-oxopropanenitrile.
Molecular Properties
| Compound Name | 3-(4-amino-2-methylsulfanyl-1,3-thiazol-5-yl)-2,2-dimethyl-3-oxopropanenitrile |
| PubChem CID | 139355688 |
| Molecular Formula | C9H11N3OS2 |
| Molecular Weight | 241.34 g/mol |
| Exact Mass | 241.03 |
| IUPAC Name | 3-(4-amino-2-methylsulfanyl-1,3-thiazol-5-yl)-2,2-dimethyl-3-oxopropanenitrile |
| SMILES | CSc1nc(N)c(C(=O)C(C)(C)C#N)s1 |
| InChI | InChI=1S/C9H11N3OS2/c1-9(2,4-10)6(13)5-7(11)12-8(14-3)15-5/h11H2,1-3H3 |
| InChIKey | FEBSMXJDTBFGOY-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 79.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.34 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-(4-amino-2-methylsulfanyl-1,3-thiazol-5-yl)-2,2-dimethyl-3-oxopropanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-amino-2-methylsulfanyl-1,3-thiazol-5-yl)-2,2-dimethyl-3-oxopropanenitrile?
The IUPAC name of 3-(4-amino-2-methylsulfanyl-1,3-thiazol-5-yl)-2,2-dimethyl-3-oxopropanenitrile (CID 139355688) is 3-(4-amino-2-methylsulfanyl-1,3-thiazol-5-yl)-2,2-dimethyl-3-oxopropanenitrile.
What is the SMILES notation for 3-(4-amino-2-methylsulfanyl-1,3-thiazol-5-yl)-2,2-dimethyl-3-oxopropanenitrile?
The canonical SMILES for 3-(4-amino-2-methylsulfanyl-1,3-thiazol-5-yl)-2,2-dimethyl-3-oxopropanenitrile is CSc1nc(N)c(C(=O)C(C)(C)C#N)s1.
What is the InChIKey of 3-(4-amino-2-methylsulfanyl-1,3-thiazol-5-yl)-2,2-dimethyl-3-oxopropanenitrile?
The InChIKey is FEBSMXJDTBFGOY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11N3OS2/c1-9(2,4-10)6(13)5-7(11)12-8(14-3)15-5/h11H2,1-3H3.
What are the key properties of 3-(4-amino-2-methylsulfanyl-1,3-thiazol-5-yl)-2,2-dimethyl-3-oxopropanenitrile?
3-(4-amino-2-methylsulfanyl-1,3-thiazol-5-yl)-2,2-dimethyl-3-oxopropanenitrile has a molecular weight of 241.34 g/mol, XLogP of 2.18, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-amino-2-methylsulfanyl-1,3-thiazol-5-yl)-2,2-dimethyl-3-oxopropanenitrile is sourced from PubChem (CID 139355688), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).