C27H33N3O4 — CID 139356293
4-[2-[4-(2,3-dihydro-1,4-benzodioxin-6-ylmethylamino)piperidin-1-yl]ethyl]-6-methoxy-1-methylquinolin-2-one (PubChem CID 139356293) has the molecular formula C27H33N3O4 and a molecular weight of 463.58 g/mol. Its IUPAC name is 4-[2-[4-(2,3-dihydro-1,4-benzodioxin-6-ylmethylamino)piperidin-1-yl]ethyl]-6-methoxy-1-methylquinolin-2-one.
| Compound Name | 4-[2-[4-(2,3-dihydro-1,4-benzodioxin-6-ylmethylamino)piperidin-1-yl]ethyl]-6-methoxy-1-methylquinolin-2-one |
|---|---|
| PubChem CID | 139356293 |
| Molecular Formula | C27H33N3O4 |
| Molecular Weight | 463.58 g/mol |
| Exact Mass | 463.25 |
| IUPAC Name | 4-[2-[4-(2,3-dihydro-1,4-benzodioxin-6-ylmethylamino)piperidin-1-yl]ethyl]-6-methoxy-1-methylquinolin-2-one |
| SMILES | COc1ccc2c(c1)c(CCN1CCC(NCc3ccc4c(c3)OCCO4)CC1)cc(=O)n2C |
| InChI | InChI=1S/C27H33N3O4/c1-29-24-5-4-22(32-2)17-23(24)20(16-27(29)31)7-10-30-11-8-21(9-12-30)28-18-19-3-6-25-26(15-19)34-14-13-33-25/h3-6,15-17,21,28H,7-14,18H2,1-2H3 |
| InChIKey | ZFKCZHJBKUXVFZ-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 64.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.58 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|