C16H33NO — CID 139356793
5-methoxy-2,2,4,4-tetramethyl-N-pent-4-enylhexan-1-amine (PubChem CID 139356793) has the molecular formula C16H33NO and a molecular weight of 255.45 g/mol. Its IUPAC name is 5-methoxy-2,2,4,4-tetramethyl-N-pent-4-enylhexan-1-amine.
| Compound Name | 5-methoxy-2,2,4,4-tetramethyl-N-pent-4-enylhexan-1-amine |
|---|---|
| PubChem CID | 139356793 |
| Molecular Formula | C16H33NO |
| Molecular Weight | 255.45 g/mol |
| Exact Mass | 255.26 |
| IUPAC Name | 5-methoxy-2,2,4,4-tetramethyl-N-pent-4-enylhexan-1-amine |
| SMILES | C=CCCCNCC(C)(C)CC(C)(C)C(C)OC |
| InChI | InChI=1S/C16H33NO/c1-8-9-10-11-17-13-15(3,4)12-16(5,6)14(2)18-7/h8,14,17H,1,9-13H2,2-7H3 |
| InChIKey | YEIVHNJZUSBIQB-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.45 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|