C17H23IO5 — CID 139357132
[5,6-bis(2-hydroxypropan-2-yl)-7-oxabicyclo[2.2.1]hepta-1,3,5-trien-2-yl] 2-iodo-2-methylbutanoate (PubChem CID 139357132) has the molecular formula C17H23IO5 and a molecular weight of 434.27 g/mol. Its IUPAC name is [5,6-bis(2-hydroxypropan-2-yl)-7-oxabicyclo[2.2.1]hepta-1,3,5-trien-2-yl] 2-iodo-2-methylbutanoate.
| Compound Name | [5,6-bis(2-hydroxypropan-2-yl)-7-oxabicyclo[2.2.1]hepta-1,3,5-trien-2-yl] 2-iodo-2-methylbutanoate |
|---|---|
| PubChem CID | 139357132 |
| Molecular Formula | C17H23IO5 |
| Molecular Weight | 434.27 g/mol |
| Exact Mass | 434.06 |
| IUPAC Name | [5,6-bis(2-hydroxypropan-2-yl)-7-oxabicyclo[2.2.1]hepta-1,3,5-trien-2-yl] 2-iodo-2-methylbutanoate |
| SMILES | CCC(C)(I)C(=O)Oc1cc2oc1c(C(C)(C)O)c2C(C)(C)O |
| InChI | InChI=1S/C17H23IO5/c1-7-17(6,18)14(19)23-10-8-9-11(15(2,3)20)12(13(10)22-9)16(4,5)21/h8,20-21H,7H2,1-6H3 |
| InChIKey | OOSDIVNOFVYCBU-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.27 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|