About 2-bicyclo[2.2.1]hept-5-enylmethyl 3-(3,5-ditert-butylphenyl)propanoate
2-bicyclo[2.2.1]hept-5-enylmethyl 3-(3,5-ditert-butylphenyl)propanoate (PubChem CID 139357211) has the molecular formula C25H36O2
and a molecular weight of 368.56 g/mol. Its IUPAC name is 2-bicyclo[2.2.1]hept-5-enylmethyl 3-(3,5-ditert-butylphenyl)propanoate.
Molecular Properties
| Compound Name | 2-bicyclo[2.2.1]hept-5-enylmethyl 3-(3,5-ditert-butylphenyl)propanoate |
| PubChem CID | 139357211 |
| Molecular Formula | C25H36O2 |
| Molecular Weight | 368.56 g/mol |
| Exact Mass | 368.27 |
| IUPAC Name | 2-bicyclo[2.2.1]hept-5-enylmethyl 3-(3,5-ditert-butylphenyl)propanoate |
| SMILES | CC(C)(C)c1cc(CCC(=O)OCC2CC3C=CC2C3)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C25H36O2/c1-24(2,3)21-13-18(14-22(15-21)25(4,5)6)8-10-23(26)27-16-20-12-17-7-9-19(20)11-17/h7,9,13-15,17,19-20H,8,10-12,16H2,1-6H3 |
| InChIKey | UMZPSZAOUJEUNR-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 368.56 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-bicyclo[2.2.1]hept-5-enylmethyl 3-(3,5-ditert-butylphenyl)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bicyclo[2.2.1]hept-5-enylmethyl 3-(3,5-ditert-butylphenyl)propanoate?
The IUPAC name of 2-bicyclo[2.2.1]hept-5-enylmethyl 3-(3,5-ditert-butylphenyl)propanoate (CID 139357211) is 2-bicyclo[2.2.1]hept-5-enylmethyl 3-(3,5-ditert-butylphenyl)propanoate.
What is the SMILES notation for 2-bicyclo[2.2.1]hept-5-enylmethyl 3-(3,5-ditert-butylphenyl)propanoate?
The canonical SMILES for 2-bicyclo[2.2.1]hept-5-enylmethyl 3-(3,5-ditert-butylphenyl)propanoate is CC(C)(C)c1cc(CCC(=O)OCC2CC3C=CC2C3)cc(C(C)(C)C)c1.
What is the InChIKey of 2-bicyclo[2.2.1]hept-5-enylmethyl 3-(3,5-ditert-butylphenyl)propanoate?
The InChIKey is UMZPSZAOUJEUNR-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H36O2/c1-24(2,3)21-13-18(14-22(15-21)25(4,5)6)8-10-23(26)27-16-20-12-17-7-9-19(20)11-17/h7,9,13-15,17,19-20H,8,10-12,16H2,1-6H3.
What are the key properties of 2-bicyclo[2.2.1]hept-5-enylmethyl 3-(3,5-ditert-butylphenyl)propanoate?
2-bicyclo[2.2.1]hept-5-enylmethyl 3-(3,5-ditert-butylphenyl)propanoate has a molecular weight of 368.56 g/mol, XLogP of 5.97, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bicyclo[2.2.1]hept-5-enylmethyl 3-(3,5-ditert-butylphenyl)propanoate is sourced from PubChem (CID 139357211), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).