C21H20ClN5O — CID 139357337
(5-chloro-9,11,14-triazatetracyclo[8.7.0.03,8.011,15]heptadeca-1(10),2,4,6,8,12,14,16-octaen-16-yl)-[(3R,5S)-3,5-dimethylpiperazin-1-yl]methanone (PubChem CID 139357337) has the molecular formula C21H20ClN5O and a molecular weight of 393.88 g/mol. Its IUPAC name is (5-chloro-9,11,14-triazatetracyclo[8.7.0.03,8.011,15]heptadeca-1(10),2,4,6,8,12,14,16-octaen-16-yl)-[(3R,5S)-3,5-dimethylpiperazin-1-yl]methanone.
| Compound Name | (5-chloro-9,11,14-triazatetracyclo[8.7.0.03,8.011,15]heptadeca-1(10),2,4,6,8,12,14,16-octaen-16-yl)-[(3R,5S)-3,5-dimethylpiperazin-1-yl]methanone |
|---|---|
| PubChem CID | 139357337 |
| Molecular Formula | C21H20ClN5O |
| Molecular Weight | 393.88 g/mol |
| Exact Mass | 393.14 |
| IUPAC Name | (5-chloro-9,11,14-triazatetracyclo[8.7.0.03,8.011,15]heptadeca-1(10),2,4,6,8,12,14,16-octaen-16-yl)-[(3R,5S)-3,5-dimethylpiperazin-1-yl]methanone |
| SMILES | C[C@@H]1CN(C(=O)c2cc3cc4cc(Cl)ccc4nc3n3ccnc23)C[C@H](C)N1 |
| InChI | InChI=1S/C21H20ClN5O/c1-12-10-26(11-13(2)24-12)21(28)17-9-15-7-14-8-16(22)3-4-18(14)25-19(15)27-6-5-23-20(17)27/h3-9,12-13,24H,10-11H2,1-2H3/t12-,13+ |
| InChIKey | DXQKFWIWMGSJKP-BETUJISGSA-N |
| XLogP | 3.51 |
| TPSA | 62.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.88 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|