About N-(5-amino-3,3-difluoro-4-methyl-2-propan-2-ylpentyl)methanesulfonamide
N-(5-amino-3,3-difluoro-4-methyl-2-propan-2-ylpentyl)methanesulfonamide (PubChem CID 139357605) has the molecular formula C10H22F2N2O2S
and a molecular weight of 272.36 g/mol. Its IUPAC name is N-(5-amino-3,3-difluoro-4-methyl-2-propan-2-ylpentyl)methanesulfonamide.
Molecular Properties
| Compound Name | N-(5-amino-3,3-difluoro-4-methyl-2-propan-2-ylpentyl)methanesulfonamide |
| PubChem CID | 139357605 |
| Molecular Formula | C10H22F2N2O2S |
| Molecular Weight | 272.36 g/mol |
| Exact Mass | 272.14 |
| IUPAC Name | N-(5-amino-3,3-difluoro-4-methyl-2-propan-2-ylpentyl)methanesulfonamide |
| SMILES | CC(C)C(CNS(C)(=O)=O)C(F)(F)C(C)CN |
| InChI | InChI=1S/C10H22F2N2O2S/c1-7(2)9(6-14-17(4,15)16)10(11,12)8(3)5-13/h7-9,14H,5-6,13H2,1-4H3 |
| InChIKey | JMCRBVSOSQWXIZ-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.36 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(5-amino-3,3-difluoro-4-methyl-2-propan-2-ylpentyl)methanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(5-amino-3,3-difluoro-4-methyl-2-propan-2-ylpentyl)methanesulfonamide?
The IUPAC name of N-(5-amino-3,3-difluoro-4-methyl-2-propan-2-ylpentyl)methanesulfonamide (CID 139357605) is N-(5-amino-3,3-difluoro-4-methyl-2-propan-2-ylpentyl)methanesulfonamide.
What is the SMILES notation for N-(5-amino-3,3-difluoro-4-methyl-2-propan-2-ylpentyl)methanesulfonamide?
The canonical SMILES for N-(5-amino-3,3-difluoro-4-methyl-2-propan-2-ylpentyl)methanesulfonamide is CC(C)C(CNS(C)(=O)=O)C(F)(F)C(C)CN.
What is the InChIKey of N-(5-amino-3,3-difluoro-4-methyl-2-propan-2-ylpentyl)methanesulfonamide?
The InChIKey is JMCRBVSOSQWXIZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H22F2N2O2S/c1-7(2)9(6-14-17(4,15)16)10(11,12)8(3)5-13/h7-9,14H,5-6,13H2,1-4H3.
What are the key properties of N-(5-amino-3,3-difluoro-4-methyl-2-propan-2-ylpentyl)methanesulfonamide?
N-(5-amino-3,3-difluoro-4-methyl-2-propan-2-ylpentyl)methanesulfonamide has a molecular weight of 272.36 g/mol, XLogP of 1.04, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(5-amino-3,3-difluoro-4-methyl-2-propan-2-ylpentyl)methanesulfonamide is sourced from PubChem (CID 139357605), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).