About (Z)-2-[5-[(dimethyl-λ4-sulfanylidene)amino]piperidin-3-yl]-3-iminoprop-1-en-1-amine
(Z)-2-[5-[(dimethyl-λ4-sulfanylidene)amino]piperidin-3-yl]-3-iminoprop-1-en-1-amine (PubChem CID 139357850) has the molecular formula C10H20N4S
and a molecular weight of 228.37 g/mol. Its IUPAC name is (Z)-2-[5-[(dimethyl-λ4-sulfanylidene)amino]piperidin-3-yl]-3-iminoprop-1-en-1-amine.
Molecular Properties
| Compound Name | (Z)-2-[5-[(dimethyl-λ4-sulfanylidene)amino]piperidin-3-yl]-3-iminoprop-1-en-1-amine |
| PubChem CID | 139357850 |
| Molecular Formula | C10H20N4S |
| Molecular Weight | 228.37 g/mol |
| Exact Mass | 228.14 |
| IUPAC Name | (Z)-2-[5-[(dimethyl-λ4-sulfanylidene)amino]piperidin-3-yl]-3-iminoprop-1-en-1-amine |
| SMILES | [H]/N=C/C(=C\N)C1CNCC(N=S(C)C)C1 |
| InChI | InChI=1S/C10H20N4S/c1-15(2)14-10-3-8(6-13-7-10)9(4-11)5-12/h4-5,8,10-11,13H,3,6-7,12H2,1-2H3/b9-5+,11-4+ |
| InChIKey | STIPHHCHBDRAGZ-IZRNULKBSA-N |
| XLogP | 0.52 |
| TPSA | 74.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.37 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (Z)-2-[5-[(dimethyl-λ4-sulfanylidene)amino]piperidin-3-yl]-3-iminoprop-1-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-2-[5-[(dimethyl-λ4-sulfanylidene)amino]piperidin-3-yl]-3-iminoprop-1-en-1-amine?
The IUPAC name of (Z)-2-[5-[(dimethyl-λ4-sulfanylidene)amino]piperidin-3-yl]-3-iminoprop-1-en-1-amine (CID 139357850) is (Z)-2-[5-[(dimethyl-λ4-sulfanylidene)amino]piperidin-3-yl]-3-iminoprop-1-en-1-amine.
What is the SMILES notation for (Z)-2-[5-[(dimethyl-λ4-sulfanylidene)amino]piperidin-3-yl]-3-iminoprop-1-en-1-amine?
The canonical SMILES for (Z)-2-[5-[(dimethyl-λ4-sulfanylidene)amino]piperidin-3-yl]-3-iminoprop-1-en-1-amine is [H]/N=C/C(=C\N)C1CNCC(N=S(C)C)C1.
What is the InChIKey of (Z)-2-[5-[(dimethyl-λ4-sulfanylidene)amino]piperidin-3-yl]-3-iminoprop-1-en-1-amine?
The InChIKey is STIPHHCHBDRAGZ-IZRNULKBSA-N. The full InChI is InChI=1S/C10H20N4S/c1-15(2)14-10-3-8(6-13-7-10)9(4-11)5-12/h4-5,8,10-11,13H,3,6-7,12H2,1-2H3/b9-5+,11-4+.
What are the key properties of (Z)-2-[5-[(dimethyl-λ4-sulfanylidene)amino]piperidin-3-yl]-3-iminoprop-1-en-1-amine?
(Z)-2-[5-[(dimethyl-λ4-sulfanylidene)amino]piperidin-3-yl]-3-iminoprop-1-en-1-amine has a molecular weight of 228.37 g/mol, XLogP of 0.52, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-2-[5-[(dimethyl-λ4-sulfanylidene)amino]piperidin-3-yl]-3-iminoprop-1-en-1-amine is sourced from PubChem (CID 139357850), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).