About (Z)-1,1-difluoro-4-(5-methyl-1H-imidazol-2-yl)but-3-en-2-imine
(Z)-1,1-difluoro-4-(5-methyl-1H-imidazol-2-yl)but-3-en-2-imine (PubChem CID 139357886) has the molecular formula C8H9F2N3
and a molecular weight of 185.18 g/mol. Its IUPAC name is (Z)-1,1-difluoro-4-(5-methyl-1H-imidazol-2-yl)but-3-en-2-imine.
Molecular Properties
| Compound Name | (Z)-1,1-difluoro-4-(5-methyl-1H-imidazol-2-yl)but-3-en-2-imine |
| PubChem CID | 139357886 |
| Molecular Formula | C8H9F2N3 |
| Molecular Weight | 185.18 g/mol |
| Exact Mass | 185.08 |
| IUPAC Name | (Z)-1,1-difluoro-4-(5-methyl-1H-imidazol-2-yl)but-3-en-2-imine |
| SMILES | [H]/N=C(/C=C\c1ncc(C)[nH]1)C(F)F |
| InChI | InChI=1S/C8H9F2N3/c1-5-4-12-7(13-5)3-2-6(11)8(9)10/h2-4,8,11H,1H3,(H,12,13)/b3-2-,11-6- |
| InChIKey | JUTLLSOBPDDGGD-VBMJPKKGSA-N |
| XLogP | 2.02 |
| TPSA | 52.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.18 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (Z)-1,1-difluoro-4-(5-methyl-1H-imidazol-2-yl)but-3-en-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-1,1-difluoro-4-(5-methyl-1H-imidazol-2-yl)but-3-en-2-imine?
The IUPAC name of (Z)-1,1-difluoro-4-(5-methyl-1H-imidazol-2-yl)but-3-en-2-imine (CID 139357886) is (Z)-1,1-difluoro-4-(5-methyl-1H-imidazol-2-yl)but-3-en-2-imine.
What is the SMILES notation for (Z)-1,1-difluoro-4-(5-methyl-1H-imidazol-2-yl)but-3-en-2-imine?
The canonical SMILES for (Z)-1,1-difluoro-4-(5-methyl-1H-imidazol-2-yl)but-3-en-2-imine is [H]/N=C(/C=C\c1ncc(C)[nH]1)C(F)F.
What is the InChIKey of (Z)-1,1-difluoro-4-(5-methyl-1H-imidazol-2-yl)but-3-en-2-imine?
The InChIKey is JUTLLSOBPDDGGD-VBMJPKKGSA-N. The full InChI is InChI=1S/C8H9F2N3/c1-5-4-12-7(13-5)3-2-6(11)8(9)10/h2-4,8,11H,1H3,(H,12,13)/b3-2-,11-6-.
What are the key properties of (Z)-1,1-difluoro-4-(5-methyl-1H-imidazol-2-yl)but-3-en-2-imine?
(Z)-1,1-difluoro-4-(5-methyl-1H-imidazol-2-yl)but-3-en-2-imine has a molecular weight of 185.18 g/mol, XLogP of 2.02, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-1,1-difluoro-4-(5-methyl-1H-imidazol-2-yl)but-3-en-2-imine is sourced from PubChem (CID 139357886), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).