About (Z)-1,1,1-trifluoro-4-imino-3-pyrrolidin-3-ylbut-2-en-2-amine
(Z)-1,1,1-trifluoro-4-imino-3-pyrrolidin-3-ylbut-2-en-2-amine (PubChem CID 139358046) has the molecular formula C8H12F3N3
and a molecular weight of 207.20 g/mol. Its IUPAC name is (Z)-1,1,1-trifluoro-4-imino-3-pyrrolidin-3-ylbut-2-en-2-amine.
Molecular Properties
| Compound Name | (Z)-1,1,1-trifluoro-4-imino-3-pyrrolidin-3-ylbut-2-en-2-amine |
| PubChem CID | 139358046 |
| Molecular Formula | C8H12F3N3 |
| Molecular Weight | 207.20 g/mol |
| Exact Mass | 207.10 |
| IUPAC Name | (Z)-1,1,1-trifluoro-4-imino-3-pyrrolidin-3-ylbut-2-en-2-amine |
| SMILES | [H]/N=C/C(=C(\N)C(F)(F)F)C1CCNC1 |
| InChI | InChI=1S/C8H12F3N3/c9-8(10,11)7(13)6(3-12)5-1-2-14-4-5/h3,5,12,14H,1-2,4,13H2/b7-6+,12-3+ |
| InChIKey | MPQKQUOGSORKFE-IDBBQSAQSA-N |
| XLogP | 1.02 |
| TPSA | 61.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.20 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (Z)-1,1,1-trifluoro-4-imino-3-pyrrolidin-3-ylbut-2-en-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-1,1,1-trifluoro-4-imino-3-pyrrolidin-3-ylbut-2-en-2-amine?
The IUPAC name of (Z)-1,1,1-trifluoro-4-imino-3-pyrrolidin-3-ylbut-2-en-2-amine (CID 139358046) is (Z)-1,1,1-trifluoro-4-imino-3-pyrrolidin-3-ylbut-2-en-2-amine.
What is the SMILES notation for (Z)-1,1,1-trifluoro-4-imino-3-pyrrolidin-3-ylbut-2-en-2-amine?
The canonical SMILES for (Z)-1,1,1-trifluoro-4-imino-3-pyrrolidin-3-ylbut-2-en-2-amine is [H]/N=C/C(=C(\N)C(F)(F)F)C1CCNC1.
What is the InChIKey of (Z)-1,1,1-trifluoro-4-imino-3-pyrrolidin-3-ylbut-2-en-2-amine?
The InChIKey is MPQKQUOGSORKFE-IDBBQSAQSA-N. The full InChI is InChI=1S/C8H12F3N3/c9-8(10,11)7(13)6(3-12)5-1-2-14-4-5/h3,5,12,14H,1-2,4,13H2/b7-6+,12-3+.
What are the key properties of (Z)-1,1,1-trifluoro-4-imino-3-pyrrolidin-3-ylbut-2-en-2-amine?
(Z)-1,1,1-trifluoro-4-imino-3-pyrrolidin-3-ylbut-2-en-2-amine has a molecular weight of 207.20 g/mol, XLogP of 1.02, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-1,1,1-trifluoro-4-imino-3-pyrrolidin-3-ylbut-2-en-2-amine is sourced from PubChem (CID 139358046), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).