About (E)-3-benzylimino-2-(3,6-dimethylmorpholin-2-yl)prop-1-en-1-amine
(E)-3-benzylimino-2-(3,6-dimethylmorpholin-2-yl)prop-1-en-1-amine (PubChem CID 139358429) has the molecular formula C16H23N3O
and a molecular weight of 273.38 g/mol. Its IUPAC name is (E)-3-benzylimino-2-(3,6-dimethylmorpholin-2-yl)prop-1-en-1-amine.
Molecular Properties
| Compound Name | (E)-3-benzylimino-2-(3,6-dimethylmorpholin-2-yl)prop-1-en-1-amine |
| PubChem CID | 139358429 |
| Molecular Formula | C16H23N3O |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.18 |
| IUPAC Name | (E)-3-benzylimino-2-(3,6-dimethylmorpholin-2-yl)prop-1-en-1-amine |
| SMILES | CC1CNC(C)C(C(/C=N/Cc2ccccc2)=C/N)O1 |
| InChI | InChI=1S/C16H23N3O/c1-12-9-19-13(2)16(20-12)15(8-17)11-18-10-14-6-4-3-5-7-14/h3-8,11-13,16,19H,9-10,17H2,1-2H3/b15-8+,18-11+ |
| InChIKey | KHOGALSLQWNIGT-GNSLQVMYSA-N |
| XLogP | 1.87 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-3-benzylimino-2-(3,6-dimethylmorpholin-2-yl)prop-1-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-3-benzylimino-2-(3,6-dimethylmorpholin-2-yl)prop-1-en-1-amine?
The IUPAC name of (E)-3-benzylimino-2-(3,6-dimethylmorpholin-2-yl)prop-1-en-1-amine (CID 139358429) is (E)-3-benzylimino-2-(3,6-dimethylmorpholin-2-yl)prop-1-en-1-amine.
What is the SMILES notation for (E)-3-benzylimino-2-(3,6-dimethylmorpholin-2-yl)prop-1-en-1-amine?
The canonical SMILES for (E)-3-benzylimino-2-(3,6-dimethylmorpholin-2-yl)prop-1-en-1-amine is CC1CNC(C)C(C(/C=N/Cc2ccccc2)=C/N)O1.
What is the InChIKey of (E)-3-benzylimino-2-(3,6-dimethylmorpholin-2-yl)prop-1-en-1-amine?
The InChIKey is KHOGALSLQWNIGT-GNSLQVMYSA-N. The full InChI is InChI=1S/C16H23N3O/c1-12-9-19-13(2)16(20-12)15(8-17)11-18-10-14-6-4-3-5-7-14/h3-8,11-13,16,19H,9-10,17H2,1-2H3/b15-8+,18-11+.
What are the key properties of (E)-3-benzylimino-2-(3,6-dimethylmorpholin-2-yl)prop-1-en-1-amine?
(E)-3-benzylimino-2-(3,6-dimethylmorpholin-2-yl)prop-1-en-1-amine has a molecular weight of 273.38 g/mol, XLogP of 1.87, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-3-benzylimino-2-(3,6-dimethylmorpholin-2-yl)prop-1-en-1-amine is sourced from PubChem (CID 139358429), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).