C12H10F4N4 — CID 139358746
(Z)-4-[5-(2,5-difluoro-1,2-dihydropyridin-4-yl)-1H-imidazol-2-yl]-1,1-difluorobut-3-en-2-imine (PubChem CID 139358746) has the molecular formula C12H10F4N4 and a molecular weight of 286.23 g/mol. Its IUPAC name is (Z)-4-[5-(2,5-difluoro-1,2-dihydropyridin-4-yl)-1H-imidazol-2-yl]-1,1-difluorobut-3-en-2-imine.
| Compound Name | (Z)-4-[5-(2,5-difluoro-1,2-dihydropyridin-4-yl)-1H-imidazol-2-yl]-1,1-difluorobut-3-en-2-imine |
|---|---|
| PubChem CID | 139358746 |
| Molecular Formula | C12H10F4N4 |
| Molecular Weight | 286.23 g/mol |
| Exact Mass | 286.08 |
| IUPAC Name | (Z)-4-[5-(2,5-difluoro-1,2-dihydropyridin-4-yl)-1H-imidazol-2-yl]-1,1-difluorobut-3-en-2-imine |
| SMILES | [H]/N=C(/C=C\c1ncc(C2=CC(F)NC=C2F)[nH]1)C(F)F |
| InChI | InChI=1S/C12H10F4N4/c13-7-4-18-10(14)3-6(7)9-5-19-11(20-9)2-1-8(17)12(15)16/h1-5,10,12,17-18H,(H,19,20)/b2-1-,17-8- |
| InChIKey | QJSFALLKNXRWEZ-NKLPGKPXSA-N |
| XLogP | 2.80 |
| TPSA | 64.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.23 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|