About N-benzyl-2-bromo-N-[1-(2,2-dimethyl-1,3-dioxolan-4-yl)ethyl]acetamide
N-benzyl-2-bromo-N-[1-(2,2-dimethyl-1,3-dioxolan-4-yl)ethyl]acetamide (PubChem CID 139358751) has the molecular formula C16H22BrNO3
and a molecular weight of 356.26 g/mol. Its IUPAC name is N-benzyl-2-bromo-N-[1-(2,2-dimethyl-1,3-dioxolan-4-yl)ethyl]acetamide.
Molecular Properties
| Compound Name | N-benzyl-2-bromo-N-[1-(2,2-dimethyl-1,3-dioxolan-4-yl)ethyl]acetamide |
| PubChem CID | 139358751 |
| Molecular Formula | C16H22BrNO3 |
| Molecular Weight | 356.26 g/mol |
| Exact Mass | 355.08 |
| IUPAC Name | N-benzyl-2-bromo-N-[1-(2,2-dimethyl-1,3-dioxolan-4-yl)ethyl]acetamide |
| SMILES | CC(C1COC(C)(C)O1)N(Cc1ccccc1)C(=O)CBr |
| InChI | InChI=1S/C16H22BrNO3/c1-12(14-11-20-16(2,3)21-14)18(15(19)9-17)10-13-7-5-4-6-8-13/h4-8,12,14H,9-11H2,1-3H3 |
| InChIKey | UYUBNJAWERSHSC-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.26 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze N-benzyl-2-bromo-N-[1-(2,2-dimethyl-1,3-dioxolan-4-yl)ethyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzyl-2-bromo-N-[1-(2,2-dimethyl-1,3-dioxolan-4-yl)ethyl]acetamide?
The IUPAC name of N-benzyl-2-bromo-N-[1-(2,2-dimethyl-1,3-dioxolan-4-yl)ethyl]acetamide (CID 139358751) is N-benzyl-2-bromo-N-[1-(2,2-dimethyl-1,3-dioxolan-4-yl)ethyl]acetamide.
What is the SMILES notation for N-benzyl-2-bromo-N-[1-(2,2-dimethyl-1,3-dioxolan-4-yl)ethyl]acetamide?
The canonical SMILES for N-benzyl-2-bromo-N-[1-(2,2-dimethyl-1,3-dioxolan-4-yl)ethyl]acetamide is CC(C1COC(C)(C)O1)N(Cc1ccccc1)C(=O)CBr.
What is the InChIKey of N-benzyl-2-bromo-N-[1-(2,2-dimethyl-1,3-dioxolan-4-yl)ethyl]acetamide?
The InChIKey is UYUBNJAWERSHSC-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H22BrNO3/c1-12(14-11-20-16(2,3)21-14)18(15(19)9-17)10-13-7-5-4-6-8-13/h4-8,12,14H,9-11H2,1-3H3.
What are the key properties of N-benzyl-2-bromo-N-[1-(2,2-dimethyl-1,3-dioxolan-4-yl)ethyl]acetamide?
N-benzyl-2-bromo-N-[1-(2,2-dimethyl-1,3-dioxolan-4-yl)ethyl]acetamide has a molecular weight of 356.26 g/mol, XLogP of 2.95, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzyl-2-bromo-N-[1-(2,2-dimethyl-1,3-dioxolan-4-yl)ethyl]acetamide is sourced from PubChem (CID 139358751), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).