C13H13ClF2N4 — CID 139358823
(Z)-4-[5-(2-chloro-6-methyl-1,2-dihydropyridin-4-yl)-1H-imidazol-2-yl]-1,1-difluorobut-3-en-2-imine (PubChem CID 139358823) has the molecular formula C13H13ClF2N4 and a molecular weight of 298.72 g/mol. Its IUPAC name is (Z)-4-[5-(2-chloro-6-methyl-1,2-dihydropyridin-4-yl)-1H-imidazol-2-yl]-1,1-difluorobut-3-en-2-imine.
| Compound Name | (Z)-4-[5-(2-chloro-6-methyl-1,2-dihydropyridin-4-yl)-1H-imidazol-2-yl]-1,1-difluorobut-3-en-2-imine |
|---|---|
| PubChem CID | 139358823 |
| Molecular Formula | C13H13ClF2N4 |
| Molecular Weight | 298.72 g/mol |
| Exact Mass | 298.08 |
| IUPAC Name | (Z)-4-[5-(2-chloro-6-methyl-1,2-dihydropyridin-4-yl)-1H-imidazol-2-yl]-1,1-difluorobut-3-en-2-imine |
| SMILES | [H]/N=C(/C=C\c1ncc(C2=CC(Cl)NC(C)=C2)[nH]1)C(F)F |
| InChI | InChI=1S/C13H13ClF2N4/c1-7-4-8(5-11(14)19-7)10-6-18-12(20-10)3-2-9(17)13(15)16/h2-6,11,13,17,19H,1H3,(H,18,20)/b3-2-,17-9- |
| InChIKey | KBIBNBXPPUYFCC-UNLLTODYSA-N |
| XLogP | 3.16 |
| TPSA | 64.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.72 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|