About 6-methylsulfanyl-1,6-diazaspiro[3.3]heptane
6-methylsulfanyl-1,6-diazaspiro[3.3]heptane (PubChem CID 139359258) has the molecular formula C6H12N2S
and a molecular weight of 144.24 g/mol. Its IUPAC name is 6-methylsulfanyl-1,6-diazaspiro[3.3]heptane.
Molecular Properties
| Compound Name | 6-methylsulfanyl-1,6-diazaspiro[3.3]heptane |
| PubChem CID | 139359258 |
| Molecular Formula | C6H12N2S |
| Molecular Weight | 144.24 g/mol |
| Exact Mass | 144.07 |
| IUPAC Name | 6-methylsulfanyl-1,6-diazaspiro[3.3]heptane |
| SMILES | CSN1CC2(CCN2)C1 |
| InChI | InChI=1S/C6H12N2S/c1-9-8-4-6(5-8)2-3-7-6/h7H,2-5H2,1H3 |
| InChIKey | ZEKXDJJKJXYYEE-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.24 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 6-methylsulfanyl-1,6-diazaspiro[3.3]heptane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methylsulfanyl-1,6-diazaspiro[3.3]heptane?
The IUPAC name of 6-methylsulfanyl-1,6-diazaspiro[3.3]heptane (CID 139359258) is 6-methylsulfanyl-1,6-diazaspiro[3.3]heptane.
What is the SMILES notation for 6-methylsulfanyl-1,6-diazaspiro[3.3]heptane?
The canonical SMILES for 6-methylsulfanyl-1,6-diazaspiro[3.3]heptane is CSN1CC2(CCN2)C1.
What is the InChIKey of 6-methylsulfanyl-1,6-diazaspiro[3.3]heptane?
The InChIKey is ZEKXDJJKJXYYEE-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12N2S/c1-9-8-4-6(5-8)2-3-7-6/h7H,2-5H2,1H3.
What are the key properties of 6-methylsulfanyl-1,6-diazaspiro[3.3]heptane?
6-methylsulfanyl-1,6-diazaspiro[3.3]heptane has a molecular weight of 144.24 g/mol, XLogP of 0.31, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methylsulfanyl-1,6-diazaspiro[3.3]heptane is sourced from PubChem (CID 139359258), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).