About 9-propan-2-yl-1-oxa-3,9-diazaspiro[4.6]undecane
9-propan-2-yl-1-oxa-3,9-diazaspiro[4.6]undecane (PubChem CID 139359490) has the molecular formula C11H22N2O
and a molecular weight of 198.31 g/mol. Its IUPAC name is 9-propan-2-yl-1-oxa-3,9-diazaspiro[4.6]undecane.
Molecular Properties
| Compound Name | 9-propan-2-yl-1-oxa-3,9-diazaspiro[4.6]undecane |
| PubChem CID | 139359490 |
| Molecular Formula | C11H22N2O |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.17 |
| IUPAC Name | 9-propan-2-yl-1-oxa-3,9-diazaspiro[4.6]undecane |
| SMILES | CC(C)N1CCCC2(CC1)CNCO2 |
| InChI | InChI=1S/C11H22N2O/c1-10(2)13-6-3-4-11(5-7-13)8-12-9-14-11/h10,12H,3-9H2,1-2H3 |
| InChIKey | SNMQQDSGXLIQJG-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 9-propan-2-yl-1-oxa-3,9-diazaspiro[4.6]undecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-propan-2-yl-1-oxa-3,9-diazaspiro[4.6]undecane?
The IUPAC name of 9-propan-2-yl-1-oxa-3,9-diazaspiro[4.6]undecane (CID 139359490) is 9-propan-2-yl-1-oxa-3,9-diazaspiro[4.6]undecane.
What is the SMILES notation for 9-propan-2-yl-1-oxa-3,9-diazaspiro[4.6]undecane?
The canonical SMILES for 9-propan-2-yl-1-oxa-3,9-diazaspiro[4.6]undecane is CC(C)N1CCCC2(CC1)CNCO2.
What is the InChIKey of 9-propan-2-yl-1-oxa-3,9-diazaspiro[4.6]undecane?
The InChIKey is SNMQQDSGXLIQJG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22N2O/c1-10(2)13-6-3-4-11(5-7-13)8-12-9-14-11/h10,12H,3-9H2,1-2H3.
What are the key properties of 9-propan-2-yl-1-oxa-3,9-diazaspiro[4.6]undecane?
9-propan-2-yl-1-oxa-3,9-diazaspiro[4.6]undecane has a molecular weight of 198.31 g/mol, XLogP of 1.20, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 9-propan-2-yl-1-oxa-3,9-diazaspiro[4.6]undecane is sourced from PubChem (CID 139359490), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).