C19H22F3N7O — CID 139359769
N-[(Z)-2-[4-(3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl)pyrimidin-2-yl]-2-[5-(trifluoromethyl)-2H-pyrazin-1-yl]ethenyl]methanimine (PubChem CID 139359769) has the molecular formula C19H22F3N7O and a molecular weight of 421.43 g/mol. Its IUPAC name is N-[(Z)-2-[4-(3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl)pyrimidin-2-yl]-2-[5-(trifluoromethyl)-2H-pyrazin-1-yl]ethenyl]methanimine.
| Compound Name | N-[(Z)-2-[4-(3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl)pyrimidin-2-yl]-2-[5-(trifluoromethyl)-2H-pyrazin-1-yl]ethenyl]methanimine |
|---|---|
| PubChem CID | 139359769 |
| Molecular Formula | C19H22F3N7O |
| Molecular Weight | 421.43 g/mol |
| Exact Mass | 421.18 |
| IUPAC Name | N-[(Z)-2-[4-(3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl)pyrimidin-2-yl]-2-[5-(trifluoromethyl)-2H-pyrazin-1-yl]ethenyl]methanimine |
| SMILES | C=N/C=C(/c1nccc(N2CCN3CCOCC3C2)n1)N1C=C(C(F)(F)F)N=CC1 |
| InChI | InChI=1S/C19H22F3N7O/c1-23-10-15(28-5-4-24-16(12-28)19(20,21)22)18-25-3-2-17(26-18)29-7-6-27-8-9-30-13-14(27)11-29/h2-4,10,12,14H,1,5-9,11,13H2/b15-10- |
| InChIKey | WTISXAOUBVUACL-GDNBJRDFSA-N |
| XLogP | 1.79 |
| TPSA | 69.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.43 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|