C22H24F3N9 — CID 139359900
N-[(Z)-2-[4-[(8aS)-4-(1H-pyrazol-4-yl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]pyrimidin-2-yl]-2-[5-(trifluoromethyl)-2H-pyrazin-1-yl]ethenyl]methanimine (PubChem CID 139359900) has the molecular formula C22H24F3N9 and a molecular weight of 471.49 g/mol. Its IUPAC name is N-[(Z)-2-[4-[(8aS)-4-(1H-pyrazol-4-yl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]pyrimidin-2-yl]-2-[5-(trifluoromethyl)-2H-pyrazin-1-yl]ethenyl]methanimine.
| Compound Name | N-[(Z)-2-[4-[(8aS)-4-(1H-pyrazol-4-yl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]pyrimidin-2-yl]-2-[5-(trifluoromethyl)-2H-pyrazin-1-yl]ethenyl]methanimine |
|---|---|
| PubChem CID | 139359900 |
| Molecular Formula | C22H24F3N9 |
| Molecular Weight | 471.49 g/mol |
| Exact Mass | 471.21 |
| IUPAC Name | N-[(Z)-2-[4-[(8aS)-4-(1H-pyrazol-4-yl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]pyrimidin-2-yl]-2-[5-(trifluoromethyl)-2H-pyrazin-1-yl]ethenyl]methanimine |
| SMILES | C=N/C=C(/c1nccc(N2CC(c3cn[nH]c3)N3CCC[C@H]3C2)n1)N1C=C(C(F)(F)F)N=CC1 |
| InChI | InChI=1S/C22H24F3N9/c1-26-11-17(32-8-6-27-19(14-32)22(23,24)25)21-28-5-4-20(31-21)33-12-16-3-2-7-34(16)18(13-33)15-9-29-30-10-15/h4-6,9-11,14,16,18H,1-3,7-8,12-13H2,(H,29,30)/b17-11-/t16-,18?/m0/s1 |
| InChIKey | RCUXATBQCIWNDE-HMSVGDKXSA-N |
| XLogP | 3.01 |
| TPSA | 88.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.49 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|