C20H24N6O — CID 139360861
N-[3-[(2R)-1-(4-methyl-1,2,4-triazol-3-yl)propan-2-yl]phenyl]-4,5,6,7-tetrahydro-1H-indazole-3-carboxamide (PubChem CID 139360861) has the molecular formula C20H24N6O and a molecular weight of 364.45 g/mol. Its IUPAC name is N-[3-[(2R)-1-(4-methyl-1,2,4-triazol-3-yl)propan-2-yl]phenyl]-4,5,6,7-tetrahydro-1H-indazole-3-carboxamide.
| Compound Name | N-[3-[(2R)-1-(4-methyl-1,2,4-triazol-3-yl)propan-2-yl]phenyl]-4,5,6,7-tetrahydro-1H-indazole-3-carboxamide |
|---|---|
| PubChem CID | 139360861 |
| Molecular Formula | C20H24N6O |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.20 |
| IUPAC Name | N-[3-[(2R)-1-(4-methyl-1,2,4-triazol-3-yl)propan-2-yl]phenyl]-4,5,6,7-tetrahydro-1H-indazole-3-carboxamide |
| SMILES | C[C@H](Cc1nncn1C)c1cccc(NC(=O)c2n[nH]c3c2CCCC3)c1 |
| InChI | InChI=1S/C20H24N6O/c1-13(10-18-24-21-12-26(18)2)14-6-5-7-15(11-14)22-20(27)19-16-8-3-4-9-17(16)23-25-19/h5-7,11-13H,3-4,8-10H2,1-2H3,(H,22,27)(H,23,25)/t13-/m1/s1 |
| InChIKey | UZYUEQCKIBYFIO-CYBMUJFWSA-N |
| XLogP | 3.02 |
| TPSA | 88.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |