C11H21N — CID 139361102
(4Z)-N,N,2,4-tetramethylhepta-4,6-dien-3-amine (PubChem CID 139361102) has the molecular formula C11H21N and a molecular weight of 167.30 g/mol. Its IUPAC name is (4Z)-N,N,2,4-tetramethylhepta-4,6-dien-3-amine.
| Compound Name | (4Z)-N,N,2,4-tetramethylhepta-4,6-dien-3-amine |
|---|---|
| PubChem CID | 139361102 |
| Molecular Formula | C11H21N |
| Molecular Weight | 167.30 g/mol |
| Exact Mass | 167.17 |
| IUPAC Name | (4Z)-N,N,2,4-tetramethylhepta-4,6-dien-3-amine |
| SMILES | C=C/C=C(/C)C(C(C)C)N(C)C |
| InChI | InChI=1S/C11H21N/c1-7-8-10(4)11(9(2)3)12(5)6/h7-9,11H,1H2,2-6H3/b10-8- |
| InChIKey | ASYYGFUFDUPCFY-NTMALXAHSA-N |
| XLogP | 2.70 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.30 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|