About 4-[(3-methylpyrrolidin-1-yl)methyl]-2-(trifluoromethyl)-7-azabicyclo[4.2.0]octa-1(6),2-diene
4-[(3-methylpyrrolidin-1-yl)methyl]-2-(trifluoromethyl)-7-azabicyclo[4.2.0]octa-1(6),2-diene (PubChem CID 139361174) has the molecular formula C14H19F3N2
and a molecular weight of 272.31 g/mol. Its IUPAC name is 4-[(3-methylpyrrolidin-1-yl)methyl]-2-(trifluoromethyl)-7-azabicyclo[4.2.0]octa-1(6),2-diene.
Molecular Properties
| Compound Name | 4-[(3-methylpyrrolidin-1-yl)methyl]-2-(trifluoromethyl)-7-azabicyclo[4.2.0]octa-1(6),2-diene |
| PubChem CID | 139361174 |
| Molecular Formula | C14H19F3N2 |
| Molecular Weight | 272.31 g/mol |
| Exact Mass | 272.15 |
| IUPAC Name | 4-[(3-methylpyrrolidin-1-yl)methyl]-2-(trifluoromethyl)-7-azabicyclo[4.2.0]octa-1(6),2-diene |
| SMILES | CC1CCN(CC2C=C(C(F)(F)F)C3=C(C2)NC3)C1 |
| InChI | InChI=1S/C14H19F3N2/c1-9-2-3-19(7-9)8-10-4-12(14(15,16)17)11-6-18-13(11)5-10/h4,9-10,18H,2-3,5-8H2,1H3 |
| InChIKey | TUKGVMCRHCZECZ-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.31 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-[(3-methylpyrrolidin-1-yl)methyl]-2-(trifluoromethyl)-7-azabicyclo[4.2.0]octa-1(6),2-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(3-methylpyrrolidin-1-yl)methyl]-2-(trifluoromethyl)-7-azabicyclo[4.2.0]octa-1(6),2-diene?
The IUPAC name of 4-[(3-methylpyrrolidin-1-yl)methyl]-2-(trifluoromethyl)-7-azabicyclo[4.2.0]octa-1(6),2-diene (CID 139361174) is 4-[(3-methylpyrrolidin-1-yl)methyl]-2-(trifluoromethyl)-7-azabicyclo[4.2.0]octa-1(6),2-diene.
What is the SMILES notation for 4-[(3-methylpyrrolidin-1-yl)methyl]-2-(trifluoromethyl)-7-azabicyclo[4.2.0]octa-1(6),2-diene?
The canonical SMILES for 4-[(3-methylpyrrolidin-1-yl)methyl]-2-(trifluoromethyl)-7-azabicyclo[4.2.0]octa-1(6),2-diene is CC1CCN(CC2C=C(C(F)(F)F)C3=C(C2)NC3)C1.
What is the InChIKey of 4-[(3-methylpyrrolidin-1-yl)methyl]-2-(trifluoromethyl)-7-azabicyclo[4.2.0]octa-1(6),2-diene?
The InChIKey is TUKGVMCRHCZECZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19F3N2/c1-9-2-3-19(7-9)8-10-4-12(14(15,16)17)11-6-18-13(11)5-10/h4,9-10,18H,2-3,5-8H2,1H3.
What are the key properties of 4-[(3-methylpyrrolidin-1-yl)methyl]-2-(trifluoromethyl)-7-azabicyclo[4.2.0]octa-1(6),2-diene?
4-[(3-methylpyrrolidin-1-yl)methyl]-2-(trifluoromethyl)-7-azabicyclo[4.2.0]octa-1(6),2-diene has a molecular weight of 272.31 g/mol, XLogP of 2.69, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(3-methylpyrrolidin-1-yl)methyl]-2-(trifluoromethyl)-7-azabicyclo[4.2.0]octa-1(6),2-diene is sourced from PubChem (CID 139361174), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).