About 2-[3-[2-(1,3,4-oxadiazol-2-yl)ethyl]phenyl]-4-(trifluoromethyl)-3H-isoindol-1-one
2-[3-[2-(1,3,4-oxadiazol-2-yl)ethyl]phenyl]-4-(trifluoromethyl)-3H-isoindol-1-one (PubChem CID 139361208) has the molecular formula C19H14F3N3O2
and a molecular weight of 373.33 g/mol. Its IUPAC name is 2-[3-[2-(1,3,4-oxadiazol-2-yl)ethyl]phenyl]-4-(trifluoromethyl)-3H-isoindol-1-one.
Molecular Properties
| Compound Name | 2-[3-[2-(1,3,4-oxadiazol-2-yl)ethyl]phenyl]-4-(trifluoromethyl)-3H-isoindol-1-one |
| PubChem CID | 139361208 |
| Molecular Formula | C19H14F3N3O2 |
| Molecular Weight | 373.33 g/mol |
| Exact Mass | 373.10 |
| IUPAC Name | 2-[3-[2-(1,3,4-oxadiazol-2-yl)ethyl]phenyl]-4-(trifluoromethyl)-3H-isoindol-1-one |
| SMILES | O=C1c2cccc(C(F)(F)F)c2CN1c1cccc(CCc2nnco2)c1 |
| InChI | InChI=1S/C19H14F3N3O2/c20-19(21,22)16-6-2-5-14-15(16)10-25(18(14)26)13-4-1-3-12(9-13)7-8-17-24-23-11-27-17/h1-6,9,11H,7-8,10H2 |
| InChIKey | SVKRBACBLJHGHZ-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 59.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 373.33 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[3-[2-(1,3,4-oxadiazol-2-yl)ethyl]phenyl]-4-(trifluoromethyl)-3H-isoindol-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-[2-(1,3,4-oxadiazol-2-yl)ethyl]phenyl]-4-(trifluoromethyl)-3H-isoindol-1-one?
The IUPAC name of 2-[3-[2-(1,3,4-oxadiazol-2-yl)ethyl]phenyl]-4-(trifluoromethyl)-3H-isoindol-1-one (CID 139361208) is 2-[3-[2-(1,3,4-oxadiazol-2-yl)ethyl]phenyl]-4-(trifluoromethyl)-3H-isoindol-1-one.
What is the SMILES notation for 2-[3-[2-(1,3,4-oxadiazol-2-yl)ethyl]phenyl]-4-(trifluoromethyl)-3H-isoindol-1-one?
The canonical SMILES for 2-[3-[2-(1,3,4-oxadiazol-2-yl)ethyl]phenyl]-4-(trifluoromethyl)-3H-isoindol-1-one is O=C1c2cccc(C(F)(F)F)c2CN1c1cccc(CCc2nnco2)c1.
What is the InChIKey of 2-[3-[2-(1,3,4-oxadiazol-2-yl)ethyl]phenyl]-4-(trifluoromethyl)-3H-isoindol-1-one?
The InChIKey is SVKRBACBLJHGHZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H14F3N3O2/c20-19(21,22)16-6-2-5-14-15(16)10-25(18(14)26)13-4-1-3-12(9-13)7-8-17-24-23-11-27-17/h1-6,9,11H,7-8,10H2.
What are the key properties of 2-[3-[2-(1,3,4-oxadiazol-2-yl)ethyl]phenyl]-4-(trifluoromethyl)-3H-isoindol-1-one?
2-[3-[2-(1,3,4-oxadiazol-2-yl)ethyl]phenyl]-4-(trifluoromethyl)-3H-isoindol-1-one has a molecular weight of 373.33 g/mol, XLogP of 4.03, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-[2-(1,3,4-oxadiazol-2-yl)ethyl]phenyl]-4-(trifluoromethyl)-3H-isoindol-1-one is sourced from PubChem (CID 139361208), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).