C22H19FN2O4 — CID 139362396
N-[(2-fluoro-4-pyridinyl)methyl]-6-phenylmethoxy-2,3-dihydro-1,4-benzodioxine-3-carboxamide (PubChem CID 139362396) has the molecular formula C22H19FN2O4 and a molecular weight of 394.40 g/mol. Its IUPAC name is N-[(2-fluoro-4-pyridinyl)methyl]-6-phenylmethoxy-2,3-dihydro-1,4-benzodioxine-3-carboxamide.
| Compound Name | N-[(2-fluoro-4-pyridinyl)methyl]-6-phenylmethoxy-2,3-dihydro-1,4-benzodioxine-3-carboxamide |
|---|---|
| PubChem CID | 139362396 |
| Molecular Formula | C22H19FN2O4 |
| Molecular Weight | 394.40 g/mol |
| Exact Mass | 394.13 |
| IUPAC Name | N-[(2-fluoro-4-pyridinyl)methyl]-6-phenylmethoxy-2,3-dihydro-1,4-benzodioxine-3-carboxamide |
| SMILES | O=C(NCc1ccnc(F)c1)C1COc2ccc(OCc3ccccc3)cc2O1 |
| InChI | InChI=1S/C22H19FN2O4/c23-21-10-16(8-9-24-21)12-25-22(26)20-14-28-18-7-6-17(11-19(18)29-20)27-13-15-4-2-1-3-5-15/h1-11,20H,12-14H2,(H,25,26) |
| InChIKey | DHPYDWNYBFBXBA-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.40 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|