About N-tert-butyl-2-(4,4-difluorocyclohexyl)acetamide
N-tert-butyl-2-(4,4-difluorocyclohexyl)acetamide (PubChem CID 139362529) has the molecular formula C12H21F2NO
and a molecular weight of 233.30 g/mol. Its IUPAC name is N-tert-butyl-2-(4,4-difluorocyclohexyl)acetamide.
Molecular Properties
| Compound Name | N-tert-butyl-2-(4,4-difluorocyclohexyl)acetamide |
| PubChem CID | 139362529 |
| Molecular Formula | C12H21F2NO |
| Molecular Weight | 233.30 g/mol |
| Exact Mass | 233.16 |
| IUPAC Name | N-tert-butyl-2-(4,4-difluorocyclohexyl)acetamide |
| SMILES | CC(C)(C)NC(=O)CC1CCC(F)(F)CC1 |
| InChI | InChI=1S/C12H21F2NO/c1-11(2,3)15-10(16)8-9-4-6-12(13,14)7-5-9/h9H,4-8H2,1-3H3,(H,15,16) |
| InChIKey | IFGIIOZXIAJPRN-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.30 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-tert-butyl-2-(4,4-difluorocyclohexyl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-tert-butyl-2-(4,4-difluorocyclohexyl)acetamide?
The IUPAC name of N-tert-butyl-2-(4,4-difluorocyclohexyl)acetamide (CID 139362529) is N-tert-butyl-2-(4,4-difluorocyclohexyl)acetamide.
What is the SMILES notation for N-tert-butyl-2-(4,4-difluorocyclohexyl)acetamide?
The canonical SMILES for N-tert-butyl-2-(4,4-difluorocyclohexyl)acetamide is CC(C)(C)NC(=O)CC1CCC(F)(F)CC1.
What is the InChIKey of N-tert-butyl-2-(4,4-difluorocyclohexyl)acetamide?
The InChIKey is IFGIIOZXIAJPRN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21F2NO/c1-11(2,3)15-10(16)8-9-4-6-12(13,14)7-5-9/h9H,4-8H2,1-3H3,(H,15,16).
What are the key properties of N-tert-butyl-2-(4,4-difluorocyclohexyl)acetamide?
N-tert-butyl-2-(4,4-difluorocyclohexyl)acetamide has a molecular weight of 233.30 g/mol, XLogP of 3.12, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-tert-butyl-2-(4,4-difluorocyclohexyl)acetamide is sourced from PubChem (CID 139362529), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).