C14H21N — CID 139362585
4-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-1-methyl-2,3,6,7-tetrahydroazepine (PubChem CID 139362585) has the molecular formula C14H21N and a molecular weight of 203.33 g/mol. Its IUPAC name is 4-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-1-methyl-2,3,6,7-tetrahydroazepine.
| Compound Name | 4-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-1-methyl-2,3,6,7-tetrahydroazepine |
|---|---|
| PubChem CID | 139362585 |
| Molecular Formula | C14H21N |
| Molecular Weight | 203.33 g/mol |
| Exact Mass | 203.17 |
| IUPAC Name | 4-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-1-methyl-2,3,6,7-tetrahydroazepine |
| SMILES | C=C/C(=C\C=C/C)C1=CCCN(C)CC1 |
| InChI | InChI=1S/C14H21N/c1-4-6-8-13(5-2)14-9-7-11-15(3)12-10-14/h4-6,8-9H,2,7,10-12H2,1,3H3/b6-4-,13-8+ |
| InChIKey | LWWNQBZNGORHQF-RUMQPUKBSA-N |
| XLogP | 3.33 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.33 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|