About (3S,4S)-3-methoxy-1,4-dimethylpyrrolidine
(3S,4S)-3-methoxy-1,4-dimethylpyrrolidine (PubChem CID 139364384) has the molecular formula C7H15NO
and a molecular weight of 129.20 g/mol. Its IUPAC name is (3S,4S)-3-methoxy-1,4-dimethylpyrrolidine.
Molecular Properties
| Compound Name | (3S,4S)-3-methoxy-1,4-dimethylpyrrolidine |
| PubChem CID | 139364384 |
| Molecular Formula | C7H15NO |
| Molecular Weight | 129.20 g/mol |
| Exact Mass | 129.12 |
| IUPAC Name | (3S,4S)-3-methoxy-1,4-dimethylpyrrolidine |
| SMILES | CO[C@@H]1CN(C)C[C@@H]1C |
| InChI | InChI=1S/C7H15NO/c1-6-4-8(2)5-7(6)9-3/h6-7H,4-5H2,1-3H3/t6-,7+/m0/s1 |
| InChIKey | RBRIVPKBTYDNPW-NKWVEPMBSA-N |
| XLogP | 0.58 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 129.20 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3S,4S)-3-methoxy-1,4-dimethylpyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S,4S)-3-methoxy-1,4-dimethylpyrrolidine?
The IUPAC name of (3S,4S)-3-methoxy-1,4-dimethylpyrrolidine (CID 139364384) is (3S,4S)-3-methoxy-1,4-dimethylpyrrolidine.
What is the SMILES notation for (3S,4S)-3-methoxy-1,4-dimethylpyrrolidine?
The canonical SMILES for (3S,4S)-3-methoxy-1,4-dimethylpyrrolidine is CO[C@@H]1CN(C)C[C@@H]1C.
What is the InChIKey of (3S,4S)-3-methoxy-1,4-dimethylpyrrolidine?
The InChIKey is RBRIVPKBTYDNPW-NKWVEPMBSA-N. The full InChI is InChI=1S/C7H15NO/c1-6-4-8(2)5-7(6)9-3/h6-7H,4-5H2,1-3H3/t6-,7+/m0/s1.
What are the key properties of (3S,4S)-3-methoxy-1,4-dimethylpyrrolidine?
(3S,4S)-3-methoxy-1,4-dimethylpyrrolidine has a molecular weight of 129.20 g/mol, XLogP of 0.58, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3S,4S)-3-methoxy-1,4-dimethylpyrrolidine is sourced from PubChem (CID 139364384), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).